Erythro-canabisine H
PubChem CID: 636543
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cannabisin H, Erythro-canabisine H, 403647-08-5, (E)-3-[4-[(1S,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide, 2-propenamide, 3-[4-[[(1S,2S)-2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl]oxy]-3-methoxyphenyl]-N-[2-(4-hydroxyphenyl)ethyl]-, (2E)-, 3-{4-[2-Hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-1-hydroxymethyl-ethoxy]-3-methoxy-phenyl}-N-[2-(4-hydroxy-phenyl)-ethyl]-acrylamide, Erythro-1-(4-hydroxy-3-methoxyphenyl)-2-{4-{2-[N-2-(4-hydroxyphenyl)ethyl]carbamoylethenyl-2-methoxyphenoxyl}}-1,3-propanodiol, rel-(2E)-3-(4-{[(1R,2R)-2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl]oxy}-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]acrylamide, (E)-3-(4-((1S,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl)oxy-3-methoxyphenyl)-N-(2-(4-hydroxyphenyl)ethyl)prop-2-enamide, 2-propenamide, 3-(4-(((1S,2S)-2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl)oxy)-3-methoxyphenyl)-N-(2-(4-hydroxyphenyl)ethyl)-, (2E)-, 3-(4-(2-Hydroxy-2-(4-hydroxy-3-methoxy-phenyl)-1-hydroxymethyl-ethoxy)-3-methoxy-phenyl)-N-(2-(4-hydroxy-phenyl)-ethyl)-acrylamide, Erythro-1-(4-hydroxy-3-methoxyphenyl)-2-(4-(2-(N-2-(4-hydroxyphenyl)ethyl)carbamoylethenyl-2-methoxyphenoxyl))-1,3-propanodiol, rel-(2E)-3-(4-(((1R,2R)-2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-1-(hydroxymethyl)ethyl)oxy)-3-methoxyphenyl)-N-(2-(4-hydroxyphenyl)ethyl)acrylamide, AKOS040763580, FS-8124 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 138.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CCCC1CCCCC1)CCC1CCC(CCCC2CCCCC2)CC1 |
| Np Classifier Class | Cinnamic acid amides, Neolignans |
| Deep Smiles | OC[C@@H][C@H]cccccc6)OC)))O)))))O))Occcccc6OC))))/C=C/C=O)NCCcccccc6))O |
| Heavy Atom Count | 37.0 |
| Scaffold Graph Node Level | OC(CCC1CCC(OCCC2CCCCC2)CC1)NCCC1CCCCC1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 698.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (E)-3-[4-[(1S,2S)-1,3-dihydroxy-1-(4-hydroxy-3-methoxyphenyl)propan-2-yl]oxy-3-methoxyphenyl]-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lignans, neolignans and related compounds |
| Xlogp | 2.3 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C28H31NO8 |
| Scaffold Graph Node Bond Level | O=C(C=Cc1ccc(OCCc2ccccc2)cc1)NCCc1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PJAFJMNWVUKNOR-MGBVTPAKSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.25 |
| Logs | -4.418 |
| Rotatable Bond Count | 12.0 |
| Logd | 2.673 |
| Synonyms | erythro-canabisine h |
| Esol Class | Soluble |
| Functional Groups | CO, c/C=C/C(=O)NC, cO, cOC |
| Compound Name | Erythro-canabisine H |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 509.205 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 509.205 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 509.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.690341000000002 |
| Inchi | InChI=1S/C28H31NO8/c1-35-24-16-20(7-10-22(24)32)28(34)26(17-30)37-23-11-5-19(15-25(23)36-2)6-12-27(33)29-14-13-18-3-8-21(31)9-4-18/h3-12,15-16,26,28,30-32,34H,13-14,17H2,1-2H3,(H,29,33)/b12-6+/t26-,28-/m0/s1 |
| Smiles | COC1=C(C=CC(=C1)/C=C/C(=O)NCCC2=CC=C(C=C2)O)O[C@@H](CO)[C@H](C3=CC(=C(C=C3)O)OC)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Phenylpropanoids (C6-C3), Lignans |
- 1. Outgoing r'ship
FOUND_INto/from Hibiscus Abelmoschus (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Hibiscus Aculeatus (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Hibiscus Cancellatus (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Hibiscus Canescens (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Hibiscus Cannabinus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Hibiscus Esculentus (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Hibiscus Ficulneus (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Hibiscus Furcatus (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Hibiscus Hirtus (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Hibiscus Hispidissimus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Hibiscus Lampas (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Hibiscus Lunariifolius (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Hibiscus Manihot (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Hibiscus Micranthus (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Hibiscus Mutabilis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Hibiscus Ovalifolius (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Hibiscus Pas (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Hibiscus Platanifolius (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Hibiscus Populneus (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Hibiscus Rosa-Sinensis (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Hibiscus Sabdariffa (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Hibiscus Schizopetalus (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Hibiscus Surattensis (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Hibiscus Syriacus (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Hibiscus Taiwanensis (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Hibiscus Tiliaceus (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Hibiscus Tilliaceus (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Hibiscus Trionum (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Hibiscus Vitifolius (Plant) Rel Props:Reference: