Glyceofuran
PubChem CID: 629096
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Glyceofuran, FLURXOFTUKXKQN-UHFFFAOYSA-N, LMPK12070111, 2-(1-Hydroxy-1-methylethyl)-6H-[1]benzofuro[3,2-c]furo[3,2-g]chromene-6a,9(11ah)-diol #, 2-(1-Hydroxy-1-methylethyl)-6H-benzofuro[3,2-c]furo[3,2-g][1]benzopyran-6a,9(11aH)-diol, 9CI |
|---|---|
| Topological Polar Surface Area | 92.3 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | FLURXOFTUKXKQN-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Synonyms | 2-(1-Hydroxy-1-methylethyl)-6H-benzofuro[3,2-c]furo[3,2-g][1]benzopyran-6a,9(11aH)-diol, 9CI, 2-(1-Hydroxy-1-methylethyl)-6H-benzofuro[3,2-c]furo[3,2-g][1]benzopyran-6a,9(11ah)-diol, 9ci |
| Heavy Atom Count | 26.0 |
| Compound Name | Glyceofuran |
| Kingdom | Organic compounds |
| Description | Isolated from cotyledons and hypocotyls of Glycine max after treatment with Pseudomonas pisi or sodium iodoacetate. Glyceofuran is found in soy bean and pulses. |
| Exact Mass | 354.11 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 354.11 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 567.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 354.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-(2-hydroxypropan-2-yl)-7,11,20-trioxapentacyclo[11.7.0.02,10.04,8.014,19]icosa-2(10),3,5,8,14(19),15,17-heptaene-13,17-diol |
| Total Atom Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Isoflavonoids |
| Inchi | InChI=1S/C20H18O6/c1-19(2,22)17-6-10-5-12-15(8-14(10)25-17)24-9-20(23)13-4-3-11(21)7-16(13)26-18(12)20/h3-8,18,21-23H,9H2,1-2H3 |
| Smiles | CC(C)(C1=CC2=CC3=C(C=C2O1)OCC4(C3OC5=C4C=CC(=C5)O)O)O |
| Xlogp | 1.7 |
| Superclass | Phenylpropanoids and polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Furanoisoflavonoids |
| Taxonomy Direct Parent | Pterocarpans |
| Molecular Formula | C20H18O6 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all