(-)-Variabilin
PubChem CID: 627142
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Variabilin, 370102-93-5, CID 44428627, Variabilin?, (6aS,11aS)-3,9-dimethoxy-6,11a-dihydro-[1]benzofuro[3,2-c]chromen-6a-ol, SCHEMBL13743175, VVPGAJNPGZZNBM-UHFFFAOYSA-N, AKOS040735078, B0005-458301, 3,9-Dimethoxy-6H-[1]benzofuro[3,2-c]chromen-6a(11ah)-ol #, 6H-Benzofuro[3,2-c][1]benzopyran-6a(11aH)-ol, 3,9-dimethoxy-, (6aR-cis)- |
|---|---|
| Topological Polar Surface Area | 57.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | VVPGAJNPGZZNBM-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | 6a-Hydroxy-3,9-dimethoxypterocarpan, Homopisatin, Variabilin? |
| Heavy Atom Count | 22.0 |
| Compound Name | (-)-Variabilin |
| Kingdom | Organic compounds |
| Description | Isolated from leaves or cotyledons of Lens culinaris (lentil) and Trifolium pratense (red clover). Homopisatin is found in many foods, some of which are lentils, herbs and spices, tea, and pulses. |
| Exact Mass | 300.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 300.1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 416.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 300.3 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,9-dimethoxy-6,11a-dihydro-[1]benzofuro[3,2-c]chromen-6a-ol |
| Total Atom Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Isoflavonoids |
| Inchi | InChI=1S/C17H16O5/c1-19-10-3-5-12-14(7-10)21-9-17(18)13-6-4-11(20-2)8-15(13)22-16(12)17/h3-8,16,18H,9H2,1-2H3 |
| Smiles | COC1=CC2=C(C=C1)C3C(CO2)(C4=C(O3)C=C(C=C4)OC)O |
| Xlogp | 1.9 |
| Superclass | Phenylpropanoids and polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Furanoisoflavonoids |
| Taxonomy Direct Parent | Pterocarpans |
| Molecular Formula | C17H16O5 |
- 1. Outgoing r'ship
FOUND_INto/from Lens Culinaris (Plant) Rel Props:Source_db:fooddb_chem_all