Linalyl butyrate
PubChem CID: 62321
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Linalyl butyrate, 78-36-4, 3,7-Dimethylocta-1,6-dien-3-yl butyrate, Linalyl butanoate, 3,7-dimethylocta-1,6-dien-3-yl butanoate, Butyric acid, linalyl ester, 1,5-Dimethyl-1-vinyl-4-hexenyl butyrate, BUTANOIC ACID, 1-ETHENYL-1,5-DIMETHYL-4-HEXENYL ESTER, FEMA No. 2639, Butyric Acid Linalyl Ester, 3,7-Dimethyl-1,6-octadien-3-yl butyrate, Butyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester, 1,6-Octadien-3-ol, 3,7-dimethyl-, butyrate, UNII-7K9F6ZOH3S, 3,7-Dimethyl-1,6-octadien-3-yl butanoate, 1-Ethenyl-1,5-dimethyl-4-hexenyl butanoate, EINECS 201-109-8, NSC 46144, AI3-24201, LINALOOL BUTYRATE, Butanoic acid, 1-ethenyl-1,5-dimethyl-4-hexen-1-yl ester, NSC-46144, 7K9F6ZOH3S, LINALYL BUTYRATE [FHFI], DTXSID20861635, 3,7-DIMETHYL-1,6-OCTADIEN-3-OL BUTYRATE, Butyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester (8CI), linalylbutyrat, MFCD00048716, SCHEMBL310250, FEMA 2639, DTXCID70810532, Linalyl butyrate, >=95%, FG, CHEBI:171782, NSC46144, AKOS027320567, CS-W014706, AS-64035, Butanoic acid,5-dimethyl-4-hexenyl ester, L0275, NS00012792, D91261, Butyric acid,5-dimethyl-1-vinyl-4-hexenyl ester, Butyric acid, 1, 5-dimethyl-1-vinyl-4-hexenyl ester, Q27268463, 201-109-8 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Acyclic monoterpenoids |
| Deep Smiles | CCCC=O)OCCCC=CC)C)))))C=C))C |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Prenol lipids |
| Description | Linalyl butyrate is used in perfumery and food flavouring. Present in oils of kumquat peel, lavender and Artemesia porrecta var. coerulea. It is also found in herbs and spices and fruits. |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 262.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,7-dimethylocta-1,6-dien-3-yl butanoate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 4.1 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C14H24O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | FHLGUOHLUFIAAA-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6428571428571429 |
| Logs | -4.397 |
| Rotatable Bond Count | 8.0 |
| State | Liquid |
| Logd | 3.989 |
| Synonyms | 1-Ethenyl-1,5-dimethyl-4-hexenyl butanoate, 1,5-Dimethyl-1-vinyl-4-hexenyl butyrate, 1,6-Octadien-3-ol, 3,7-dimethyl-, butyrate, 3,7-Dimethyl-1,6-octadien-3-yl butanoate, 3,7-Dimethyl-1,6-octadien-3-yl butyrate, Butanoic acid, 1-ethenyl-1,5-dimethyl-4-hexen-1-yl ester, Butanoic acid, 1-ethenyl-1,5-dimethyl-4-hexenyl ester, Butyric acid, 1, 5-dimethyl-1-vinyl-4-hexenyl ester, Butyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester, Butyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester (8CI), Butyric acid, linalyl ester, FEMA 2639, Linalyl butanoate, Linalyl butyrate, Linalyl butyric acid, Butyric acid, 1,5-dimethyl-1-vinyl-4-hexenyl ester (8ci), 3,7-Dimethylocta-1,6-dien-3-yl butanoic acid, linalyl butanoate, linalyl butyrate |
| Esol Class | Soluble |
| Functional Groups | C=CC, CC=C(C)C, COC(C)=O |
| Compound Name | Linalyl butyrate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 224.178 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 224.178 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 224.34 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.701732799999999 |
| Inchi | InChI=1S/C14H24O2/c1-6-9-13(15)16-14(5,7-2)11-8-10-12(3)4/h7,10H,2,6,8-9,11H2,1,3-5H3 |
| Smiles | CCCC(=O)OC(C)(CCC=C(C)C)C=C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Acyclic monoterpenoids |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Acuminata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Anogeissus Acuminata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Artemisia Absinthium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2018.1496856 - 4. Outgoing r'ship
FOUND_INto/from Artemisia Vulgaris (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060403 - 5. Outgoing r'ship
FOUND_INto/from Atropa Acuminata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Barleria Acuminata (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Bauhinia Acuminata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Callicarpa Acuminata (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Camptotheca Acuminata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Cola Acuminata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Ehretia Acuminata (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Eurya Acuminata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Gymnosporia Acuminata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ixora Acuminata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Magnolia Acuminata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Mentha Piperita (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1261 - 17. Outgoing r'ship
FOUND_INto/from Musa Acuminata (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Nicotiana Acuminata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Origanum Vulgare (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2011.10643917 - 20. Outgoing r'ship
FOUND_INto/from Pimpinella Acuminata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Pycnandra Acuminata (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Rheedia Acuminata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Salvia Sclarea (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1261 - 24. Outgoing r'ship
FOUND_INto/from Tiliacora Acuminata (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Trichoscypha Acuminata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Uvaria Acuminata (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Waitzia Acuminata (Plant) Rel Props:Reference: