Caffeoylmalic Acid
PubChem CID: 6124299
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Caffeoylmalic Acid, Coumaroyl malic acid, 2-O-Caffeoylmalic acid, 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxybutanedioic acid, 8EY7S5QS7D, 149197-97-7, 92344-57-5, 2-((3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl)oxy)butanedioic acid, Butanedioic acid, ((3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl)oxy)-, 2-(((2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl)oxy)butanedioic acid, Butanedioic acid, 2-((3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl)oxy)-, Butanedioic acid, 2-(((2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl)oxy)-, 2-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid, (-)-Phaselic acid, 2-((3-(3,4-dihydroxyphenyl)prop-2-enoyl)oxy)butanedioate, 2-{[3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioate, 2-(((2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl)oxy)butanedioic acid, 2-((E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl)oxybutanedioic acid, Phaseolic acid?, (S)-Phaselic acid, UNII-8EY7S5QS7D, CHEMBL393293, 2-O-(trans-caffeoyl)malic acid, SCHEMBL19894754, CHEBI:169040, DTXSID301031926, AKOS040734961, Q18379746, (E)-2-((3-(3,4-Dihydroxyphenyl)acryloyl)oxy)succinicacid, (E)-2-((3-(3,4-Dihydroxyphenyl)acryloyl)oxy)succinic acid |
|---|---|
| Topological Polar Surface Area | 141.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 21.0 |
| Description | Isolated from leaves of French bean (Phaseolus vulgaris) and from Trifolium pratense (red clover). L-Malic acid caffeate is found in many foods, some of which are yellow wax bean, herbs and spices, tea, and pulses. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 430.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | O42713 |
| Iupac Name | 2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxybutanedioic acid |
| Prediction Hob | 0.0 |
| Class | Cinnamic acids and derivatives |
| Xlogp | 0.6 |
| Superclass | Phenylpropanoids and polyketides |
| Subclass | Hydroxycinnamic acids and derivatives |
| Molecular Formula | C13H12O8 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PMKQSEYPLQIEAY-DUXPYHPUSA-N |
| Fcsp3 | 0.1538461538461538 |
| Logs | -1.214 |
| Rotatable Bond Count | 7.0 |
| Logd | 3.579 |
| Synonyms | (S)-Phaselic acid, Caffeoyl-L-malic acid, Caffeoylmalic acid, L-Malic acid caffeate, Phaseolic acid?, Caffeoylmalate, 2-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}butanedioate, L-Malate caffeate, L-Malic acid caffeic acid |
| Substituent Name | Cinnamic acid ester, Coumaric acid or derivatives, Tricarboxylic acid or derivatives, Phenylpropene, Styrene, 1,2-diphenol, Phenol, Fatty acid ester, Fatty acyl, Benzenoid, Monocyclic benzene moiety, Alpha,beta-unsaturated carboxylic ester, Enoate ester, Carboxylic acid ester, Ether, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aromatic homomonocyclic compound |
| Compound Name | Caffeoylmalic Acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 296.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 296.053 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 296.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Esol | -1.816660771428571 |
| Inchi | InChI=1S/C13H12O8/c14-8-3-1-7(5-9(8)15)2-4-12(18)21-10(13(19)20)6-11(16)17/h1-5,10,14-15H,6H2,(H,16,17)(H,19,20)/b4-2+ |
| Smiles | C1=CC(=C(C=C1/C=C/C(=O)OC(CC(=O)O)C(=O)O)O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Coumaric acids and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Isodon Rubescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Marrubium Velutinum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Raphanus Sativus (Plant) Rel Props:Source_db:fooddb_chem_all