Olean-12-ene-3,28-diol
PubChem CID: 608886
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Olean-12-ene-3.beta.,28-diol, Olean-12-ene-3,28-diol, (3.beta.)-, Oprea1_748027, Olean-12-ene-3,28-diol, Olean-12-ene-3,28-diol #, DTXSID00862160, PSZDOEIIIJFCFE-UHFFFAOYSA-N, AKOS000544483, DB-052606, AG-690/12868816 |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 32.0 |
| Description | Found in grapes, olives, pot marigold (Calendula officinalis) and other plants Erythrodiol is a pentacyclic triterpene, found in the non-glyceride fraction of olive pomace oil (Olive pomace oil, also known as "orujo" olive oil, is a blend of refined-pomace oil and virgin olive oil, fit for human consumption). Pentacyclic triterpenes are natural compounds which are widely distributed in plants. These natural products have been demonstrated to possess anti-inflammatory properties. Triterpenoids have been reported to possess antioxidant properties, since they prevent lipid peroxidation and suppress superoxide anion generation. The triterpenes have a history of medicinal use in many Asian countries. Erythrodiol exhibits both pro- and anti-inflammatory properties depending on chemical structure and dose and may be useful in modulating the immune response, further studies are required to confirm the immunomodulatory behaviour of this triterpenoid, and characterise the mechanisms underlying the biphasic nature of some aspects of the inflammatory response. (PMID: 17292619, 15522132) |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 810.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-ol |
| Nih Violation | False |
| Class | Prenol lipids |
| Xlogp | 7.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Triterpenoids |
| Molecular Formula | C30H50O2 |
| Inchi Key | PSZDOEIIIJFCFE-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Synonyms | (3b)-Olean-12-ene-3,28-diol, (3beta)-Olean-12-ene-3,28-diol, (3β)-olean-12-ene-3,28-diol, 3b-Erythrodiol, 3b,28-Dihydroxy-ole-12-ene, 3beta-Erythrodiol, 3beta,28-Dihydroxy-ole-12-ene, 3β-erythrodiol, 3β,28-dihydroxy-ole-12-ene, Erythrodiol, Homoolestranol, Olean-12-ene-3beta,28-diol, Oleanolic alcohol |
| Substituent Name | Oleanane triterpenoid, Cyclic alcohol, Secondary alcohol, Hydrocarbon derivative, Primary alcohol, Organooxygen compound, Alcohol, Aliphatic homopolycyclic compound |
| Compound Name | Olean-12-ene-3,28-diol |
| Kingdom | Organic compounds |
| Exact Mass | 442.381 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 442.381 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 442.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H50O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-24,31-32H,9-19H2,1-7H3 |
| Smiles | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1)C)CO)C |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Source_db:fooddb_chem_all