Alpha-d-xylopyranose
PubChem CID: 6027
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Alpha-d-xylopyranose, 6763-34-4, a-D-Xylopyranose, alpha-D-Xylose, (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol, Holzzucker, Losan, alpha-xylose, alpha-Xylopyranose (9CI), .alpha.-d-Xylose, Wood sugar, C791ZE5K1W, 130550-15-1, .ALPHA.-XYLOSE, .ALPHA.-D-XYLOPYRANOSE, CCRIS 9027, Xylo-Pfan, Xylose, pure, CHEBI:28518, XYLOPYRANOSE, .ALPHA.-D-, (2S,3R,4S,5R)-tetrahydro-2H-pyran-2,3,4,5-tetraol, 31178-70-8, Pentopyranose #, rel-(2S,3R,4S,5R)-Tetrahydro-2H-pyran-2,3,4,5-tetraol, XYS, AI3-19010, Xylopyranose, alpha-D-, WURCS=2.0/1,1,0/(a212h-1a_1-5)/1/, WURCS=2.0/1,1,0/[a212h-1a_1-5]/1/, MFCD20731172, alpha-xylopyranose, BRN 1562108, , A-D-Xylose, ?-D-XYLOPYRANOSE, I+/-lpha-D-Xylopyranose, Holzzucker, Losan, -Xylose, bmse000026, bmse000898, UNII-C791ZE5K1W, SCHEMBL345574, DTXSID301316752, tetrahydropyran-2,3,4,5-tetraol, GAA76334, AKOS024462556, DB03389, DS-17846, CS-0018338, NS00068512, EN300-95483, C01394, C02205, D70642, D85124, alpha-D-xylose, D-xylose, xylose, XYLOPYRANOSE, Q212774, (2S,3R,4S,5R)-tetrahydropyran-2,3,4,5-tetrol, Z1270381574, 53A5B1A2-9576-4133-B5C5-F31D97E015B3, alpha-D-xylopyranose (closed ring structure, complete stereochemistry), 608-587-0, 614-092-0 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O[C@@H]CO[C@@H][C@@H][C@H]6O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2S,3R,4S,5R)-oxane-2,3,4,5-tetrol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.5 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SRBFZHDQGSBBOR-LECHCGJUSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 1.0 |
| Logs | -0.019 |
| Rotatable Bond Count | 0.0 |
| Logd | -1.959 |
| Synonyms | alpha-d-xylose |
| Esol Class | Highly soluble |
| Functional Groups | CO, CO[C@@H](C)O |
| Compound Name | Alpha-d-xylopyranose |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | 1.1317940000000002 |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5+/m1/s1 |
| Smiles | C1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Alstonia Muelleriana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Artemisia Cina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Chlamydomonas Reinhardtii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Coreopsis Nodosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Dacrydium Cupressinum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Glycine Tomentella (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Haematococcus Lacustris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Nicotiana Undulata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Reference:ISBN:9788185042138 - 10. Outgoing r'ship
FOUND_INto/from Panax Schinseng (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Passiflora Incarnata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Senecio Paludaffinis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Trigonella Grandiflora (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Tripolium Pannonicum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Uvaria Calamistrata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all