7-Decen-4-olide, (Z)-
PubChem CID: 6019677
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 63095-33-0, (Z)-5-(3-Hexenyl)dihydrofuran-2(3H)-one, .gamma.-jasmolactone, 7-Decen-4-olide, (Z)-, 0X5NW8SE54, 2(3H)-Furanone, 5-(3Z)-3-hexen-1-yldihydro-, (Z)-gamma-Jasmolactone, 2(3H)-Furanone, 5-(3Z)-3-hexenyldihydro-, EINECS 263-852-4, 5-[(Z)-hex-3-enyl]oxolan-2-one, cis-.gamma.-Jasmine lactone, (Z)-.GAMMA.-JASMOLACTONE, (xi)-(Z)-5-(3-Hexenyl)dihydro-2(3H)-furanone, 2(3H)-Furanone, 5-(3-hexenyl)dihydro-, (Z)-, FEMA NO. 4439, Z-, (+/-)-(Z)-.GAMMA.-JASMOLACTONE, UNII-0X5NW8SE54, 5-(3Z)-3-Hexen-1-yldihydro-2(3H)-furanone, (Z)-5-(3-Hexenyl)dihydro-2(3H)-furanone, 5-(3Z)-3-Hexenyldihydro-2(3H)-furanone, cis-gamma-Jasmine Lactone, (Z)-7-decen-4-olide, 93787-95-2, SCHEMBL1771763, CIS-GAMMA-JASMINE LACTONE, CHEBI:195787, DTXSID401014995, (+/-)-(Z)-GAMMA-JASMOLACTONE, DB-310495, NS00012576, 5-(3Z)-3-Hexen-1-yldihydro-2(3H)-furanone, (Z)-5-(Hex-3-en-1-yl)dihydrofuran-2(3H)-one, 5-[(3Z)-HEX-3-EN-1-YL]OXOLAN-2-ONE, Q27237316 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCC1 |
| Np Classifier Class | Lactones |
| Deep Smiles | CC/C=CCCCCCC=O)O5 |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Lactones |
| Description | Constituent of peppermint oil. (xi)-(Z)-5-(3-Hexenyl)dihydro-2(3H)-furanone is found in herbs and spices. |
| Scaffold Graph Node Level | OC1CCCO1 |
| Classyfire Subclass | Gamma butyrolactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 173.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-[(Z)-hex-3-enyl]oxolan-2-one |
| Class | Lactones |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 2.4 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Gamma butyrolactones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H16O2 |
| Scaffold Graph Node Bond Level | O=C1CCCO1 |
| Inchi Key | NKNGVPNCSFZRSM-ARJAWSKDSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | γ-jasmolactone |
| Esol Class | Soluble |
| Functional Groups | C/C=CC, COC(C)=O |
| Compound Name | 7-Decen-4-olide, (Z)- |
| Kingdom | Organic compounds |
| Exact Mass | 168.115 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 168.115 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 168.23 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H16O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h3-4,9H,2,5-8H2,1H3/b4-3- |
| Smiles | CC/C=C\CCC1CCC(=O)O1 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Gamma butyrolactones |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Persica (Plant) Rel Props:Reference:ISBN:9788172362461