7-Methylquinolin-8-ol
PubChem CID: 594448
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 7-methylquinolin-8-ol, 5541-68-4, 7-METHYL-QUINOLIN-8-OL, 7-Methyl-8-quinolinol, 8-Quinolinol, 7-methyl-, 7-Methyl-8-hydroxyquinoline, 8-Hydroxy-7-methylquinoline, MFCD00168979, 7-Methyl-8-quinolinol #, Oprea1_354732, 8-Hydroxy-7-methyl-chinolin, 8-Hydroxy-7-methyl-quinoline, SCHEMBL623096, DTXSID10344104, LUOZEWPJSYBORW-UHFFFAOYSA-N, SMSSF-0625051, ALBB-021962, AKOS006282751, AMS_CNC_ID-445001274, ET-0010, SB37644, DB-359912, CS-0312982, EN300-7403889, Q63409536 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 33.1 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Deep Smiles | Ccccccc6O))nccc6 |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | C1CCC2NCCCC2C1 |
| Classyfire Subclass | 8-hydroxyquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 160.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7-methylquinolin-8-ol |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 2.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H9NO |
| Scaffold Graph Node Bond Level | c1ccc2ncccc2c1 |
| Inchi Key | LUOZEWPJSYBORW-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 8-quinolinol, 7-methyl |
| Esol Class | Soluble |
| Functional Groups | cO, cnc |
| Compound Name | 7-Methylquinolin-8-ol |
| Exact Mass | 159.068 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 159.068 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 159.18 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H9NO/c1-7-4-5-8-3-2-6-11-9(8)10(7)12/h2-6,12H,1H3 |
| Smiles | CC1=C(C2=C(C=CC=N2)C=C1)O |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.892840