Luteolin 7-(6''-apiosylglucoside)
PubChem CID: 59383825
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SCHEMBL13237065, Luteolin 7-(6''-apiosylglucoside) |
|---|---|
| Topological Polar Surface Area | 245.0 |
| Hydrogen Bond Donor Count | 9.0 |
| Inchi Key | CNKAEXQTIMWDBP-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | 3',4',5,7-Tetrahydroxyflavone 7-O-[b-D-apiofuranosyl-(1->6)-b-D-glucopyranoside], Luteolin 7-(6''-apiosylglucoside), Luteolin 7-[apiosyl-(1->6)-glucoside], Luteolin 7-O-[b-D-apiofuranosyl-(1->6)-b-D-glucopyranoside] |
| Heavy Atom Count | 41.0 |
| Compound Name | Luteolin 7-(6''-apiosylglucoside) |
| Description | Luteolin 7-(6''-apiosylglucoside) is a member of the class of compounds known as flavonoid-7-o-glycosides. Flavonoid-7-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Luteolin 7-(6''-apiosylglucoside) is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Luteolin 7-(6''-apiosylglucoside) can be found in a number of food items such as red bell pepper, wild celery, yellow bell pepper, and orange bell pepper, which makes luteolin 7-(6''-apiosylglucoside) a potential biomarker for the consumption of these food products. |
| Exact Mass | 580.143 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 580.143 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 963.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 580.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7-[6-[[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxychromen-4-one |
| Total Atom Stereocenter Count | 8.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C26H28O15/c27-8-26(36)9-38-25(23(26)35)37-7-18-20(32)21(33)22(34)24(41-18)39-11-4-14(30)19-15(31)6-16(40-17(19)5-11)10-1-2-12(28)13(29)3-10/h1-6,18,20-25,27-30,32-36H,7-9H2 |
| Smiles | C1C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)O)O)O)O)O)O)O)(CO)O |
| Xlogp | -1.3 |
| Is Pains | True |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C26H28O15 |
- 1. Outgoing r'ship
FOUND_INto/from Apium Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all