4-(1Z)-1-Propen-1-ylphenol
PubChem CID: 5791138
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (Z)-4-(1-Propenyl)phenol, 85960-81-2, 4-[(Z)-prop-1-enyl]phenol, VQ6PDW0YG3, 4-Propenylphenol, (Z)-, 4-((Z)-Prop-1-enyl)phenol, Phenol, 4-(1Z)-1-propenyl-, (Z)-4-(1-Propen-1-yl)phenol, FEMA No. 4062, Z-, UNII-VQ6PDW0YG3, Phenol, 4-(1-propenyl)-, (Z)-, Phenol, 4-(1Z)-1-propen-1-yl-, 4-(1Z)-1-Propen-1-ylphenol, DTXSID101006553, p-Anol, dimer, (Z)-4-PROPENYLPHENOL, SCHEMBL1397053, 4-(prop-1-enyl)phenol, dimer, 4-PROPENYLPHENOL, CIS-, Phenol, 4-(1-propenyl), cis, DTXCID60911300, CHEBI:178622, UMFCIIBZHQXRCJ-IHWYPQMZSA-N, NSC71549, NSC-71549, 4-[(1Z)-prop-1-en-1-yl]phenol, Q27291963 |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 10.0 |
| Description | (z)-4-(1-propenyl)phenol is a member of the class of compounds known as styrenes. Styrenes are organic compounds containing an ethenylbenzene moiety (z)-4-(1-propenyl)phenol is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Within the cell, (z)-4-(1-propenyl)phenol is primarily located in the membrane (predicted from logP). |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 110.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4-[(Z)-prop-1-enyl]phenol |
| Nih Violation | False |
| Class | Benzene and substituted derivatives |
| Xlogp | 2.6 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Styrenes |
| Molecular Formula | C9H10O |
| Inchi Key | UMFCIIBZHQXRCJ-IHWYPQMZSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 1-(4-Hydroxyphenyl)-2-propene, Anol, Nikkomycin z, p-Hydroxy-b-methylstyrene, 4',5,5'',7,7''-Pentahydroxy-4'''-methoxy-3''',8-biflavone, 4'-Monomethylamentoflavone |
| Compound Name | 4-(1Z)-1-Propen-1-ylphenol |
| Kingdom | Organic compounds |
| Exact Mass | 134.073 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 134.073 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 134.17 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Inchi | InChI=1S/C9H10O/c1-2-3-8-4-6-9(10)7-5-8/h2-7,10H,1H3/b3-2- |
| Smiles | C/C=C\C1=CC=C(C=C1)O |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Styrenes |
- 1. Outgoing r'ship
FOUND_INto/from Foeniculum Vulgare (Plant) Rel Props:Source_db:fooddb_chem_all