Lucernol
PubChem CID: 5748586
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lucernol, 15402-22-9, 2,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one, 2,3,9-Trihydroxycoumestan, 2,3,9-Trihydroxy-6H-benzofuro(3,2-c)(1)benzopyran-6-one, 6H-Benzofuro(3,2-c)(1)benzopyran-6-one, 2,3,9-trihydroxy-, 2,3-Dihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one, 6,7,12-Trihydroxycoumestan, DTXSID10165518, CHEBI:171702, LMPK12090032, 2,3-Dimethoxy-alpha-methyl-Benzeneethanamine, 2,3,9-trihydroxy-[1]benzouro[3,2-c]chromen-6-one, 2,3,9-Trihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one, 9CI |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 100.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC2CCCCC2C2CC3CCCCC3C12 |
| Np Classifier Class | Coumestan |
| Deep Smiles | Occcccc6)occ5c=O)occ6ccO)cc6)O |
| Heavy Atom Count | 21.0 |
| Classyfire Class | Isoflavonoids |
| Description | Constituent of alfalfa (Medicago sativa). Lucernol is found in alfalfa and pulses. |
| Scaffold Graph Node Level | OC1OC2CCCCC2C2OC3CCCCC3C12 |
| Classyfire Subclass | Coumestans |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 440.0 |
| Database Name | fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,9-trihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.4 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H8O6 |
| Scaffold Graph Node Bond Level | O=c1oc2ccccc2c2oc3ccccc3c12 |
| Inchi Key | CJPXZAMCIOOMNF-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 2,3-Dimethoxy-alpha-methyl-benzeneethanamine, 2,3,9-Trihydroxy-6H-benzofuro(3,2-c)(1)benzopyran-6-one, 2,3,9-Trihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one, 9CI, 6,7,12-Trihydroxycoumestan, 6H-Benzofuro(3,2-c)(1)benzopyran-6-one, 2,3,9-trihydroxy-, Benzeneethanamine, 2,3-dimethoxy-alpha-methyl-, Lucernol, lucernol |
| Esol Class | Soluble |
| Functional Groups | c=O, cO, coc |
| Compound Name | Lucernol |
| Exact Mass | 284.032 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 284.032 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 284.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H8O6/c16-6-1-2-7-11(3-6)20-14-8-4-9(17)10(18)5-12(8)21-15(19)13(7)14/h1-5,16-18H |
| Smiles | C1=CC2=C(C=C1O)OC3=C2C(=O)OC4=CC(=C(C=C43)O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Isoflavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Medicago Sativa (Plant) Rel Props:Source_db:fooddb_chem_all