Nomilinic acid 17-O-beta-D-glucoside
PubChem CID: 5748431
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Nomilinic acid 17-O-beta-D-glucoside, Nomilinic acid glycoside, 125107-15-5, CCRIS 6988, Nomilinic acid 17-O-beta-D-glucopyranoside, DTXSID00925022, Limonoic acid, 1-(acetyloxy)-1,4-deepoxy-19-deoxy-O17-beta-D-glucopyranosyl-4-hydroxy-, 5-[1-(Acetyloxy)-2-carboxyethyl]-2-[(furan-3-yl)(hexopyranosyloxy)methyl]-6-(2-hydroxypropan-2-yl)-2,5,8a-trimethyl-8-oxooctahydro-2H-spiro[naphthalene-1,2'-oxirane]-3'-carboxylic acid, Spiro(naphthalene-1(2H),2'-oxirane)-5-propanoic acid, beta-(acetyloxy)-3'-carboxy-2-((S)-3-furanyl(beta-D-glucopyranosyloxy)methyl)octahydro-6-(1-hydroxy-1-methylethyl)-2,5,8a-trimethyl-8-oxo-, (betaR,1R,2S,3'S,4aR,5R,6R,8aR)- |
|---|---|
| Topological Polar Surface Area | 263.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Heavy Atom Count | 50.0 |
| Description | Nomilinic acid 17-o-beta-d-glucoside is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Nomilinic acid 17-o-beta-d-glucoside can be found in lemon, mandarin orange (clementine, tangerine), and sweet orange, which makes nomilinic acid 17-o-beta-d-glucoside a potential biomarker for the consumption of these food products. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1350.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 13.0 |
| Iupac Name | (2'S,3S,4aR,7R,8R,8aR)-8-[(1R)-1-acetyloxy-2-carboxyethyl]-3-[(S)-furan-3-yl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-7-(2-hydroxypropan-2-yl)-3,4a,8-trimethyl-5-oxospiro[2,6,7,8a-tetrahydro-1H-naphthalene-4,3'-oxirane]-2'-carboxylic acid |
| Nih Violation | True |
| Class | Saccharolipids |
| Xlogp | -0.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Molecular Formula | C34H48O16 |
| Inchi Key | MUZNNCNJBAPYJF-UNWTYGGYSA-N |
| Rotatable Bond Count | 12.0 |
| Synonyms | (2S,3's,4AR,5R,6R,8ar)-5-[(1R)-1-(acetyloxy)-2-carboxyethyl]-2-[(R)-(furan-3-yl)({[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})methyl]-6-(2-hydroxypropan-2-yl)-2,5,8a-trimethyl-8-oxo-octahydro-2H-spiro[naphthalene-1,2'-oxirane]-3'-carboxylate, Nomilinate 17-O-b-D-glucoside, Nomilinate 17-O-beta-D-glucoside, Nomilinate 17-O-β-D-glucoside, Nomilinic acid 17-O-b-D-glucoside, Nomilinic acid 17-O-β-D-glucoside |
| Compound Name | Nomilinic acid 17-O-beta-D-glucoside |
| Kingdom | Organic compounds |
| Exact Mass | 712.294 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 712.294 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 712.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 14.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Inchi | InChI=1S/C34H48O16/c1-15(36)47-21(12-22(38)39)32(5)18-7-9-31(4,34(27(50-34)28(43)44)33(18,6)20(37)11-19(32)30(2,3)45)26(16-8-10-46-14-16)49-29-25(42)24(41)23(40)17(13-35)48-29/h8,10,14,17-19,21,23-27,29,35,40-42,45H,7,9,11-13H2,1-6H3,(H,38,39)(H,43,44)/t17-,18-,19+,21-,23-,24+,25-,26+,27-,29+,31+,32-,33+,34?/m1/s1 |
| Smiles | CC(=O)O[C@H](CC(=O)O)[C@@]1([C@H]2CC[C@@](C3([C@@]2(C(=O)C[C@H]1C(C)(C)O)C)[C@H](O3)C(=O)O)(C)[C@H](C4=COC=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Saccharolipids |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Limon (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Citrus Reticulata (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all