Cinnamyl benzoate
PubChem CID: 5705112
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cinnamyl benzoate, (E)-cinnamyl benzoate, 5320-75-2, 50555-04-9, Cinnamyl alcohol, benzoate, Benzoic acid, cinnamyl ester, trans-Cinnamyl benzoate, [(E)-3-phenylprop-2-enyl] benzoate, 2-Propen-1-ol, 3-phenyl-, benzoate, (E)-, CINNAMYLBENZOATE, 2-Propen-1-ol, 3-phenyl-, benzoate, 3-Phenyl-2-propen-1-yl benzoate, EINECS 226-180-2, YD42CSO4W9, 3-Phenyl-2-propenyl Benzoate, NSC 245146, BRN 2109179, 2-Propen-1-ol, 3-phenyl-, 1-benzoate, (2E)-, AI3-36053, Cinnamyl benzoate [FIFH], UNII-YD42CSO4W9, NSC-245146, (E)-3-phenylallyl benzoate, (2E)-3-phenylprop-2-en-1-yl benzoate, 2-Propen-1-ol, 3-phenyl-, 1-benzoate, CINNAMYL BENZOATE [FHFI], FEMA NO. 4703, 2-09-00-00103 (Beilstein Handbook Reference), Cinnamyl benzoate (FIFH), 2-Propen-1-ol, 3-phenyl-, benzoate, (2E)-, ((E)-3-phenylprop-2-enyl) benzoate, MFCD00475021, Cinnamyl benzoic acid, (e)-Cinnamyl benzoic acid, 2-Propen-1-ol, benzoate, WLN: RVO2U1R, trans-Cinnamyl benzoic acid, SCHEMBL382617, CHEMBL1095237, CHEBI:174231, Cinnamyl benzoate, >=98%, FG, DTXSID501262614, NSC245146, AKOS004905721, (2E)-3-Phenylprop-2-en-1-yl benzoic acid, C3650, NS00012094, Q27294470, Z2583146334, 226-180-2 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CCCCC1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Chalcones |
| Deep Smiles | O=Ccccccc6))))))OC/C=C/cccccc6 |
| Heavy Atom Count | 18.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | OC(OCCCC1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Benzoic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 271.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [(E)-3-phenylprop-2-enyl] benzoate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Benzene and substituted derivatives |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 4.6 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Benzoic acids and derivatives |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H14O2 |
| Scaffold Graph Node Bond Level | O=C(OCC=Cc1ccccc1)c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | UARVBDPGNUHYQT-JXMROGBWSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0625 |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | Cinnamyl benzoic acid, (e)-Cinnamyl benzoate, (e)-Cinnamyl benzoic acid, trans-Cinnamyl benzoate, (2E)-3-Phenylprop-2-en-1-yl benzoic acid, trans-Cinnamyl benzoic acid, Cinnamyl benzoate, (e)-cinnamoylbenzoate, cinnamyl benzoate, cinnamyl benzoate*, cinnamyl-benzoate |
| Esol Class | Moderately soluble |
| Functional Groups | c/C=C/C, cC(=O)OC |
| Compound Name | Cinnamyl benzoate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 238.099 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 238.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 238.28 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -4.385006533333333 |
| Inchi | InChI=1S/C16H14O2/c17-16(15-11-5-2-6-12-15)18-13-7-10-14-8-3-1-4-9-14/h1-12H,13H2/b10-7+ |
| Smiles | C1=CC=C(C=C1)/C=C/COC(=O)C2=CC=CC=C2 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Benzoic acid esters |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Anodendron Affine (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cedrela Salvadorensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Cinnamomum Aromaticum (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Cinnamomum Cassia (Plant) Rel Props:Source_db:npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Diospyros Discolor (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1992.9698063 - 6. Outgoing r'ship
FOUND_INto/from Garcinia Cambogia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Hertia Cheirifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Jasminum Grandiflorum (Plant) Rel Props:Reference:ISBN:9788172361150 - 9. Outgoing r'ship
FOUND_INto/from Licaria Chrysophylla (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Magnolia Champaca (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1991.9700493 - 11. Outgoing r'ship
FOUND_INto/from Ormosia Hosiei (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Ornithoglossum Viride (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Petasites Laevigatus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Rubia Tetragona (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Schizanthus Tricolor (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Sphaeranthus Confertifolius (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Styrax Benzoin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Styrax Tonkinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all