Beauwalloside
PubChem CID: 56841099
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Beauwalloside, 31087-94-2, Card-20(22)-enolide, 16-(acetyloxy)-3-((2,6-dideoxy-3-O-methyl-alpha-L-ribo-hexopyranosyl)oxy)-14-hydroxy-, (3-beta,5-beta,16-beta)-, DTXSID601016478, ((3S,5R,8R,9S,10S,13R,14S,16S,17R)-14-hydroxy-3-((2R,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta(a)phenanthren-16-yl) acetate, [(3S,5R,8R,9S,10S,13R,14S,16S,17R)-14-hydroxy-3-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate, DTXCID101474667 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 121.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC(C2CCC3C2CCC2C4CCC(CC5CCCCC5)CC4CCC23)C1 |
| Np Classifier Class | Cardenolides |
| Deep Smiles | CO[C@@H]C[C@H]O[C@H]CC[C@][C@@H]C6)CC[C@@H][C@@H]6CC[C@][C@]6O)C[C@@H][C@@H]5C=CC=O)OC5))))))OC=O)C))))))C)))))))))C))))))O[C@H][C@@H]6O))C |
| Heavy Atom Count | 41.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | OC1CC(C2CCC3C2CCC2C4CCC(OC5CCCCO5)CC4CCC23)CO1 |
| Classyfire Subclass | Steroid lactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1080.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 13.0 |
| Iupac Name | [(3S,5R,8R,9S,10S,13R,14S,16S,17R)-14-hydroxy-3-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.4 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C32H48O9 |
| Scaffold Graph Node Bond Level | O=C1C=C(C2CCC3C2CCC2C4CCC(OC5CCCCO5)CC4CCC23)CO1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JLPDBLFIVFSOCC-NHZSRKBRSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.875 |
| Rotatable Bond Count | 6.0 |
| Synonyms | beauwalloside |
| Esol Class | Soluble |
| Functional Groups | CC(=O)OC, CC1=CC(=O)OC1, CO, COC, C[C@H](OC)OC |
| Compound Name | Beauwalloside |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 576.33 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 576.33 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 576.7 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 13.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.750507400000002 |
| Inchi | InChI=1S/C32H48O9/c1-17-29(35)24(37-5)14-27(39-17)41-21-8-10-30(3)20(13-21)6-7-23-22(30)9-11-31(4)28(19-12-26(34)38-16-19)25(40-18(2)33)15-32(23,31)36/h12,17,20-25,27-29,35-36H,6-11,13-16H2,1-5H3/t17-,20+,21-,22-,23+,24+,25-,27-,28-,29-,30-,31+,32-/m0/s1 |
| Smiles | C[C@H]1[C@@H]([C@@H](C[C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(C[C@@H]([C@@H]5C6=CC(=O)OC6)OC(=O)C)O)C)C)OC)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Steroids |
- 1. Outgoing r'ship
FOUND_INto/from Angelonia Grandiflora (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Anthocleista Grandiflora (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Aristolochia Grandiflora (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Beaumontia Brevituba (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Beaumontia Grandiflora (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Brunfelsia Grandiflora (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Campsis Grandiflora (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Centranthera Grandiflora (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Coreopsis Grandiflora (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cryptostegia Grandiflora (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Dioclea Grandiflora (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Duabanga Grandiflora (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Espeletia Grandiflora (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Gardenia Jasminoides (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Heterotheca Grandiflora (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Hymenoxys Grandiflora (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Ipomoea Grandiflora (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Kleinia Grandiflora (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Magnolia Grandiflora (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Mentha Grandiflora (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Notonia Grandiflora (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Portulaca Grandiflora (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Primula Grandiflora (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Schisandra Grandiflora (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Sesbania Grandiflora (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Sideritis Grandiflora (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Tecoma Grandiflora (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Thunbergia Grandiflora (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Trigonella Grandiflora (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Uvaria Grandiflora (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Zephyranthes Grandiflora (Plant) Rel Props:Reference: