9,19-Cyclolanost-25-en-3-ol, 24-methyl-, (3beta,24S)-
PubChem CID: 550205
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 9,19-Cyclolanost-25-en-3-ol, 24-methyl-, (3.beta.,24S)-, 9,19-Cyclo-9.beta.-lanost-25-en-3.beta.-ol, 24-methyl-, (24S)-, IXHACUTUTOCSJE-UHFFFAOYSA-N, 3a,6,6,12a-Tetramethyl-1-(1,4,5-trimethyl-5-hexenyl)tetradecahydro-1H-cyclopenta[a]cyclopropa[e]phenanthren-7-ol # |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 32.0 |
| Description | Cyclolaudenol is found in french plantain. Cyclolaudenol is found in opium Cyclolaudenol belongs to the family of Triterpenes. These are terpene molecules containing 8 isoprene units. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 781.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 15-(5,6-dimethylhept-6-en-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| Nih Violation | False |
| Class | Steroids and steroid derivatives |
| Xlogp | 10.4 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Cycloartanols and derivatives |
| Molecular Formula | C31H52O |
| Inchi Key | IXHACUTUTOCSJE-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | Cyclolaudenol, 24-Methylcycloartenol |
| Compound Name | 9,19-Cyclolanost-25-en-3-ol, 24-methyl-, (3beta,24S)- |
| Kingdom | Organic compounds |
| Exact Mass | 440.402 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 440.402 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 440.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C31H52O/c1-20(2)21(3)9-10-22(4)23-13-15-29(8)25-12-11-24-27(5,6)26(32)14-16-30(24)19-31(25,30)18-17-28(23,29)7/h21-26,32H,1,9-19H2,2-8H3 |
| Smiles | CC(CCC(C)C(=C)C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)O)C)C |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Cycloartanols and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Solanum Tuberosum (Plant) Rel Props:Source_db:fooddb_chem_all