Hydnocarpin
PubChem CID: 5489114
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Hydnocarpin, 51419-48-8, (Rac)-Hydnocarpin, 5,7-dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]chromen-4-one, Rac-Hydnocarpin, DTXSID50965736, BCA41948, HY-N7199, AKOS040760773, DA-67096, MS-28549, CS-0105215, G17671, 4H-1-Benzopyran-4-one, 2-(2,3-dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl)-5,7-dihydroxy-, trans-, 5,7-Dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4H-1-benzopyran-4-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 135.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCC3CC(C4CCCCC4)CCC3C2)CC2CCCCC12 |
| Np Classifier Class | Flavones, Flavonolignans |
| Deep Smiles | OCCOcccccc6OC%10cccccc6)OC)))O))))))))))ccc=O)cco6)cccc6O)))O |
| Heavy Atom Count | 34.0 |
| Classyfire Class | Flavonolignans |
| Scaffold Graph Node Level | OC1CC(C2CCC3OC(C4CCCCC4)COC3C2)OC2CCCCC12 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 771.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,7-dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]chromen-4-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Lignans, neolignans and related compounds |
| Xlogp | 3.3 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C25H20O9 |
| Scaffold Graph Node Bond Level | O=c1cc(-c2ccc3c(c2)OCC(c2ccccc2)O3)oc2ccccc12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | NMICSFNNFDNGEL-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.16 |
| Rotatable Bond Count | 4.0 |
| Synonyms | hydnocarpin |
| Esol Class | Moderately soluble |
| Functional Groups | CO, c=O, cO, cOC, coc |
| Compound Name | Hydnocarpin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 464.111 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 464.111 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 464.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.490364729411765 |
| Inchi | InChI=1S/C25H20O9/c1-31-20-7-13(2-4-15(20)28)25-23(11-26)33-21-6-12(3-5-18(21)34-25)19-10-17(30)24-16(29)8-14(27)9-22(24)32-19/h2-10,23,25-29H,11H2,1H3 |
| Smiles | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=CC(=C3)C4=CC(=O)C5=C(C=C(C=C5O4)O)O)CO)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Lignans, Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Aerva Javanica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Bischofia Javanica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Brucea Antidysenterica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Brucea Javanica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Brucea Mollis (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Cassia Javanica (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Chamaecrista Absus (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172363178; ISBN:9788185042084 - 8. Outgoing r'ship
FOUND_INto/from Cissus Javanica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cnesmone Javanica (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Emilia Javanica (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Epimedium Acuminatum (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Epimedium Brevicornu (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Epimedium Davidii (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Epimedium Grandiflorum (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Epimedium Koreanum (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Epimedium Pubescens (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Epimedium Sagittatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Epimedium Sempervirens (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Epimedium Wanshanense (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Epimedium Wushanense (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Hydnocarpus Kurzii (Plant) Rel Props:Reference:ISBN:9770972795006 - 22. Outgoing r'ship
FOUND_INto/from Hydnocarpus Pentandrus (Plant) Rel Props:Reference:ISBN:9788185042084; ISBN:9788190595216 - 23. Outgoing r'ship
FOUND_INto/from Hydnocarpus Wightianus (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788172362300; ISBN:9788172363178; ISBN:9788185042084 - 24. Outgoing r'ship
FOUND_INto/from Hydrocotyle Javanica (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Ixora Javanica (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Jackiella Javanica (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Lippia Javanica (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Lonicera Japonica (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/20222422 - 29. Outgoing r'ship
FOUND_INto/from Oenanthe Javanica (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Parkia Javanica (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Picrasma Javanica (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Rhus Javanica (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Sambucus Javanica (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Sesbania Javanica (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Wrightia Javanica (Plant) Rel Props:Reference: