1-Methyl-1-propylhydrazine
PubChem CID: 547724
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-Methyl-1-propylhydrazine, 4986-49-6, 1-Methyl-1-n-propylhydrazine, Hydrazine, 1-methyl-1-propyl-, 1-Methyl-1-propylhydrazine #, DTXSID50338224, JOFQXPUKJJQCPW-UHFFFAOYSA-N, AKOS018598379, Q63409114 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 29.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | CCCNN)C |
| Heavy Atom Count | 6.0 |
| Classyfire Class | Organonitrogen compounds |
| Classyfire Subclass | Hydrazines and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 28.7 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-methyl-1-propylhydrazine |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Organic nitrogen compounds |
| Xlogp | 0.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H12N2 |
| Inchi Key | JOFQXPUKJJQCPW-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | 1-methyl-1-propyl-hydrazine |
| Esol Class | Very soluble |
| Functional Groups | CN(C)N |
| Compound Name | 1-Methyl-1-propylhydrazine |
| Exact Mass | 88.1 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 88.1 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 88.15 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C4H12N2/c1-3-4-6(2)5/h3-5H2,1-2H3 |
| Smiles | CCCN(C)N |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Ligustrum Lucidum (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279