Zerumbone epoxide
PubChem CID: 5463724
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Zerumbone epoxide, Zerumbone oxide, UXYYOHOTPOQJPD-MHLOZHTBSA-N, DTXSID001316903, 2,3-Epoxy-6,9-humuladien-8-one, 22471-70-1 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 29.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCCC2CC2CCCC1 |
| Np Classifier Class | Humulane sesquiterpenoids |
| Deep Smiles | O=C/C=C/CC)C)CCCCC/C=C%11/C)))))O3)C |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Organooxygen compounds |
| Description | Constituent of ginger Zingiber zerumbet. Zerumbone oxide is found in herbs and spices. |
| Scaffold Graph Node Level | OC1CCCCC2OC2CCCC1 |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 390.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (4Z,7E)-1,5,9,9-tetramethyl-12-oxabicyclo[9.1.0]dodeca-4,7-dien-6-one |
| Nih Violation | False |
| Class | Organooxygen compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 3.3 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbonyl compounds |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H22O2 |
| Scaffold Graph Node Bond Level | O=C1C=CCCC2OC2CCC=C1 |
| Inchi Key | UXYYOHOTPOQJPD-MHLOZHTBSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | 2,3-Epoxy-6,9-humuladien-8-one, Zerumbone oxide, zerumbone oxide |
| Esol Class | Soluble |
| Functional Groups | C/C=C(/C)C(=O)/C=C/C, CC1OC1(C)C |
| Compound Name | Zerumbone epoxide |
| Kingdom | Organic compounds |
| Exact Mass | 234.162 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 234.162 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 234.33 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H22O2/c1-11-6-5-8-15(4)13(17-15)10-14(2,3)9-7-12(11)16/h6-7,9,13H,5,8,10H2,1-4H3/b9-7+,11-6- |
| Smiles | C/C/1=C/CCC2(C(O2)CC(/C=C/C1=O)(C)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Cyclic ketones |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Zingiber Zerumbet (Plant) Rel Props:Reference:ISBN:9788185042084