O-beta-D-Glucosyl-trans-zeatin
PubChem CID: 5461146
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | O-beta-D-glucosyl-trans-zeatin, trans-Zeatin-O-glucoside, 56329-06-7, O-beta-D-Glucosylzeatin, (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-2-methyl-4-(7H-purin-6-ylamino)but-2-enoxy]oxane-3,4,5-triol, CHEBI:38266, (2E)-2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-yl beta-D-glucopyranoside, (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-((E)-2-methyl-4-(7H-purin-6-ylamino)but-2-enoxy)oxane-3,4,5-triol, O-b-D-Glucosylzeatin, O-b-D-Glucosyl-trans-zeatin, DTXSID301346498, 6-((E)-4-b-D-Glucopyranosyloxy-3-methylbut-2-enylamino) purine, MZ30318, C03423, Q27104440, 6-(4-O-b-D-Glucosyl-3-methyl-trans-but-2-enyl-amino)-purine, 6-(4-O-beta-D-Glucosyl-3-methyl-trans-but-2-enyl-amino)-purine |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C(CCCC1CCCC2CCCC12)CCC1CCCCC1 |
| Np Classifier Class | Purine alkaloids |
| Deep Smiles | OC[C@H]O[C@@H]OC/C=C/CNcncncc6[nH]cn5))))))))))))/C))))[C@@H][C@H][C@@H]6O))O))O |
| Heavy Atom Count | 27.0 |
| Classyfire Class | Fatty acyls |
| Description | 6-(4-o-beta-d-glucosyl-3-methyl-trans-but-2-enyl-amino)-purine, also known as trans-zeatin-O-glucoside or O-beta-D-glucosylzeatin, is a member of the class of compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol. 6-(4-o-beta-d-glucosyl-3-methyl-trans-but-2-enyl-amino)-purine is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). 6-(4-o-beta-d-glucosyl-3-methyl-trans-but-2-enyl-amino)-purine can be found in a number of food items such as yellow wax bean, common verbena, black elderberry, and sacred lotus, which makes 6-(4-o-beta-d-glucosyl-3-methyl-trans-but-2-enyl-amino)-purine a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C(CCOC1CCCCO1)CNC1NCNC2NCNC12 |
| Classyfire Subclass | Fatty acyl glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 512.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(E)-2-methyl-4-(7H-purin-6-ylamino)but-2-enoxy]oxane-3,4,5-triol |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -0.9 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H23N5O6 |
| Scaffold Graph Node Bond Level | C(=CCOC1CCCCO1)CNc1ncnc2nc[nH]c12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | UUPDCCPAOMDMPT-HNVSNYHQSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5625 |
| Logs | -2.129 |
| Rotatable Bond Count | 7.0 |
| Logd | -0.627 |
| Synonyms | zeatin,o-beta-d-glucosyl |
| Esol Class | Very soluble |
| Functional Groups | C/C=C(/C)C, CO, CO[C@@H](C)OC, cNC, c[nH]c, cnc |
| Compound Name | O-beta-D-Glucosyl-trans-zeatin |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 381.165 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 381.165 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 381.38 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -1.4033784666666669 |
| Inchi | InChI=1S/C16H23N5O6/c1-8(2-3-17-14-10-15(19-6-18-10)21-7-20-14)5-26-16-13(25)12(24)11(23)9(4-22)27-16/h2,6-7,9,11-13,16,22-25H,3-5H2,1H3,(H2,17,18,19,20,21)/b8-2+/t9-,11-,12+,13-,16-/m1/s1 |
| Smiles | C/C(=C\CNC1=NC=NC2=C1NC=N2)/CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Pseudoalkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Cocos Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Reference:ISBN:9780896038776