Ribonic acid
PubChem CID: 5460677
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-ribonic acid, Ribonic acid, (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid, 642-98-8, 17812-24-7, CHEBI:21077, Ribonate, D-(-)-Ribonic acid, starbld0007008, SCHEMBL416686, CHEBI:33511, QXKAIJAYHKCRRA-BXXZVTAOSA-N, DTXSID801021863, AKOS006290789, C01685, Q27109369, Rel-(2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid, 99235101-DD2D-4AB2-9123-10463F65AA6F |
|---|---|
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 11.0 |
| Description | Ribonic acid is a product of the enzyme ribose 1-dehydrogenase (NADP+) [EC 1.1.1.115] (KEGG). [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 135.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2R,3R,4R)-2,3,4,5-tetrahydroxypentanoic acid |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Class | Organooxygen compounds |
| Xlogp | -2.7 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C5H10O6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | QXKAIJAYHKCRRA-BXXZVTAOSA-N |
| Fcsp3 | 0.8 |
| Logs | 0.069 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | -2.434 |
| Synonyms | D-Ribonate, D-Ribonic acid, Ribonate, Ribonic acid, 2,3,4,5-Tetrahydroxypentanoic acid |
| Compound Name | Ribonic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 166.048 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 166.048 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 166.13 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 1.1265002 |
| Inchi | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4-/m1/s1 |
| Smiles | C([C@H]([C@H]([C@H](C(=O)O)O)O)O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Sugar acids and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Aloe Africana (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Aloe Ferox (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Aloe Spicata (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Aloe Vera (Plant) Rel Props:Source_db:cmaup_ingredients