5,7-Dihydroxy-3',4',5'-trimethoxyflavone
PubChem CID: 5379265
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5,7-Dihydroxy-3',4',5'-trimethoxyflavone, 18103-42-9, tricetin 3',4',5'-trimethyl ether, Tricin 4'-Methyl Ether, 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one, 3',4',5'-O-trimethyltricetin, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4-benzopyrone, Flavone, 5,7-dihydroxy-3',4',5'-trimethoxy-, NSC-123410, 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-, MLS002707300, 2J9JJ5N2H7, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one, CHEBI:543745, NSC123410, 5, 7-Dihydroxy-3',4',5'-trimethoxyflavone, 5,7-Dihydroxy-3',4',5'-trimethoxy flavone, 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one, 5-7-dihydroxy-3-4-5-trimethoxyflavone, EINECS 242-001-0, MFCD00016924, NSC 123410, 5,7-Dihydroxy-3',4',5'-trimethoxyflavon, UNII-2J9JJ5N2H7, 5,4',5'-trimethoxyflavone, 5,4',5'-trimethoxy flavone, CHEMBL486590, SCHEMBL4918477, DTXSID70171059, HY-N7150, LMPK12110880, AKOS025287600, FS-8799, FT65911, SMR001574694, 3',4',5'-TRI-O-METHYL-TRICETIN, CS-0103228, Flavone,7-dihydroxy-3',4',5'-trimethoxy-, NS00025961, 5,7-Dihydroxy-3',4',5'-trimethoxy-Flavone, 5,7-DIHYDROXY-3,4,5-TRIMETHOXYFLAVONE, C19807, Q27105170, Flavone, 5,7-dihydroxy-3',4',5'-trimethoxy- (8CI), 4H-1-Benzopyran-4-one,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)-, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one # |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 94.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC(C2CCCCC2)CC2CCCCC12 |
| Np Classifier Class | Flavones |
| Deep Smiles | COccOC))cccc6OC))))ccc=O)cco6)cccc6O)))O |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Flavonoids |
| Description | Isolated from leaves of barley (Hordeum vulgare). 3',4',5'-Trimethoxytricetin is found in barley and cereals and cereal products. |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)OC2CCCCC12 |
| Classyfire Subclass | O-methylated flavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 506.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q15118 |
| Iupac Name | 5,7-dihydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Flavonoids |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.0 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | O-methylated flavonoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H16O7 |
| Scaffold Graph Node Bond Level | O=c1cc(-c2ccccc2)oc2ccccc12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | CPCPHNWWTJLXKQ-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.1666666666666666 |
| Logs | -3.602 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | 2.736 |
| Synonyms | 3',4',5'-Trimethoxytricetin, 5, 7-Dihydroxy-3',4',5'-trimethoxyflavone, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4-benzopyrone, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one, 5,7-Dihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one, 5,7-Dihydroxy-3',4',5'-trimethoxy flavone, 5,7-Dihydroxy-3',4',5'-trimethoxy-flavone, 5,7-Dihydroxy-3',4',5'-trimethoxyflavon, 5,7-Dihydroxy-3',4',5'-trimethoxyflavone, Dimethyl benzoylonate, Flavone, 5,7-dihydroxy-3',4',5'-trimethoxy- (8ci), Tricetin 3',4',5'-trimethyl ether, Dimethyl benzoylphosphonate, 3,4,5-tri-me ether-3,4,5,5,7-pentahydroxyflavone, 5,7-dihydroxy-3',4',5'-trimethoxy-flavone |
| Esol Class | Moderately soluble |
| Functional Groups | c=O, cO, cOC, coc |
| Compound Name | 5,7-Dihydroxy-3',4',5'-trimethoxyflavone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 344.09 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 344.09 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 344.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.5388778000000007 |
| Inchi | InChI=1S/C18H16O7/c1-22-15-4-9(5-16(23-2)18(15)24-3)13-8-12(21)17-11(20)6-10(19)7-14(17)25-13/h4-8,19-20H,1-3H3 |
| Smiles | COC1=CC(=CC(=C1OC)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | 4'-O-methylated flavonoids |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Adenia Globosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Aglaia Grandis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Anaphalis Araneosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Artemisia Kurramensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Bhesa Nitidissima (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Calycanthus Floridus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Catunaregam Tomentosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Chrysanthemum Sinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Episcia Cupreata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Hordeum Vulgare (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 11. Outgoing r'ship
FOUND_INto/from Impatiens Edgeworthii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Jasonia Candicans (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Liriodendron Tulipifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Othonna Sedifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Pterocarpus Officinalis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Ranzania Japonica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Rothmannia Wittii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Tetrapanax Papyrifer (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Vernonia Lanuginosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Zanthoxylum Myriacanthum (Plant) Rel Props:Source_db:npass_chem_all