2,3-Dehydro-4-oxo-beta-ionol
PubChem CID: 5373836
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,3-Dehydro-4-oxo-.beta.-ionol, FZJGHQBGWXPTDS-AATRIKPKSA-N, NS00113835, (e)-3-(3-hydroxybut-1-enyl)-2,4,4-trimethylcyclohexa-2,5-dienone, 3-[(1E)-3-Hydroxy-1-butenyl]-2,4,4-trimethyl-2,5-cyclohexadien-1-one # |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCCC1 |
| Deep Smiles | CC/C=C/C=CC)C=O)C=CC6C)C)))))))))O |
| Heavy Atom Count | 15.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCCCC1 |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 357.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[(E)-3-hydroxybut-1-enyl]-2,4,4-trimethylcyclohexa-2,5-dien-1-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.1 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C13H18O2 |
| Scaffold Graph Node Bond Level | O=C1C=CCC=C1 |
| Inchi Key | FZJGHQBGWXPTDS-AATRIKPKSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | 2,3-dihydro-4-oxo-β-ionol |
| Esol Class | Soluble |
| Functional Groups | C/C=C/C1=C(C)C(=O)C=CC1, CO |
| Compound Name | 2,3-Dehydro-4-oxo-beta-ionol |
| Exact Mass | 206.131 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 206.131 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 206.28 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C13H18O2/c1-9(14)5-6-11-10(2)12(15)7-8-13(11,3)4/h5-9,14H,1-4H3/b6-5+ |
| Smiles | CC1=C(C(C=CC1=O)(C)C)/C=C/C(C)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Equisetum Palustre (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2008.9700020