(Z)-1-Ethylidene-1H-indene
PubChem CID: 5372637
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (Z)-1-Ethylidene-1H-indene, (1E)-1-Ethylidene-1H-indene, DTXSID80343200, 62933-90-8, (1E)-1-ethylidene-indene, 1-Ethylidene-1H-indene #, DTXCID80820743, AKOS015905428, NS00096111 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC12 |
| Deep Smiles | C/C=CC=Ccc5cccc6 |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Indenes and isoindenes |
| Scaffold Graph Node Level | CC1CCC2CCCCC12 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 198.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (1E)-1-ethylideneindene |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C11H10 |
| Scaffold Graph Node Bond Level | C=C1C=Cc2ccccc21 |
| Inchi Key | HNZQPQACDDJLTD-XNWCZRBMSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 1-ethylidene-1h-indene |
| Esol Class | Soluble |
| Functional Groups | C/C=C1C=Ccc1 |
| Compound Name | (Z)-1-Ethylidene-1H-indene |
| Exact Mass | 142.078 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 142.078 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 142.2 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C11H10/c1-2-9-7-8-10-5-3-4-6-11(9)10/h2-8H,1H3/b9-2+ |
| Smiles | C/C=C/1\C=CC2=CC=CC=C21 |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Euryale Ferox (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1595165