2,6,11,15-Tetramethyl-hexadeca-2,6,8,10,14-pentaene
PubChem CID: 5365927
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,6,11,15-Tetramethyl-hexadeca-2,6,8,10,14-pentaene, ZUXCVSSOFQSXFF-LAJGPCJBSA-N, (6E,8E,10E)-2,6,11,15-Tetramethyl-2,6,8,10,14-hexadecapentaene # |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Apocarotenoids (C30, Ψ-Ψ) |
| Deep Smiles | C/C=CC=CC=CCCC=CC)C)))))/C))))))/CCC=CC)C |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Prenol lipids |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 363.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (6E,8E,10E)-2,6,11,15-tetramethylhexadeca-2,6,8,10,14-pentaene |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 7.9 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H32 |
| Inchi Key | ZUXCVSSOFQSXFF-LAJGPCJBSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 8.0 |
| Synonyms | (6e,8e,10e)-2,6,11,15-tetramethyl-2,6,8,10,14-hexadecapentaene |
| Esol Class | Soluble |
| Functional Groups | C/C(C)=C/C=C/C=C(/C)C, CC=C(C)C |
| Compound Name | 2,6,11,15-Tetramethyl-hexadeca-2,6,8,10,14-pentaene |
| Exact Mass | 272.25 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 272.25 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 272.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 3.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C20H32/c1-17(2)11-9-15-19(5)13-7-8-14-20(6)16-10-12-18(3)4/h7-8,11-14H,9-10,15-16H2,1-6H3/b8-7+,19-13+,20-14+ |
| Smiles | CC(=CCC/C(=C/C=C/C=C(/CCC=C(C)C)\C)/C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 3.0 |
| Egan Rule | False |
| Np Classifier Superclass | Apocarotenoids |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Maxima (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10662594