2-Methyl-2-penten-1-ol
PubChem CID: 5362851
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Methylpent-2-en-1-ol, 2-Methyl-2-penten-1-ol, (E)-2-Methyl-2-penten-1-ol, 1610-29-3, 16958-19-3, 2-PENTEN-1-OL, 2-METHYL-, (E)-2-methylpent-2-en-1-ol, 2-Methyl-2-pentene-1-ol, EINECS 216-549-6, (2E)-2-Methyl-2-penten-1-ol, (e)-2-methyl-2-pentenol, SCHEMBL712008, (2E)-2-methylpent-2-en-1-ol, DTXSID601030860, AKOS006279521, EN300-7577150 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | CC/C=C/CO))C |
| Heavy Atom Count | 7.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Alcohols and polyols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 64.599 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-2-methylpent-2-en-1-ol |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 1.5 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O |
| Inchi Key | KIKXGIRAIYTCRB-GQCTYLIASA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | 2-methyl-pent-2-en-1-al |
| Esol Class | Very soluble |
| Functional Groups | C/C=C(/C)C, CO |
| Compound Name | 2-Methyl-2-penten-1-ol |
| Exact Mass | 100.089 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 100.089 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 100.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H12O/c1-3-4-6(2)5-7/h4,7H,3,5H2,1-2H3/b6-4+ |
| Smiles | CC/C=C(\C)/CO |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279