Curdione
PubChem CID: 5362828
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Curdione, Germacr-1(10)-ene-5,8-dione, (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione, 13657-68-6, (+)-Curdione, KDPFMRXIVDLQKX-WDZFZDKYSA-N, (+)-Germacr-1(10)-ene-5,8-dione, 6,10-Dimethyl-3-(1-methylethyl)-6-cyclodecene-1,4-dione, (6Z)-6,10-dimethyl-3-(propan-2-yl)cyclodec-6-ene-1,4-dione, 3S,6E,10S)-6,10-Dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione, 3-Isopropyl-6,10-dimethyl-6-cyclodecene-1,4-dione, (3S-(3R*,6E,10R*))-, 6,10-Dimethyl-3-(1-methylethyl)-6-cyclodecene-1,4-dione, (3S-(3R*,6E,10R*))- |
|---|---|
| Topological Polar Surface Area | 34.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 17.0 |
| Description | Constituent of Curcuma zedoaria (zedoary). Curdione is found in turmeric. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 326.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (6Z)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Xlogp | 2.7 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Sesquiterpenoids |
| Molecular Formula | C15H24O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | KDPFMRXIVDLQKX-WDZFZDKYSA-N |
| Fcsp3 | 0.7333333333333333 |
| Logs | -3.101 |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Logd | 2.884 |
| Synonyms | (+)-Curdione, (+)-Germacr-1(10)-ene-5,8-dione, Curdione, Germacr-1(10)-ene-5,8-dione |
| Compound Name | Curdione |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 236.178 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 236.178 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 236.35 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Esol | -2.9089009999999997 |
| Inchi | InChI=1S/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6- |
| Smiles | CC1CC/C=C(\CC(=O)C(CC1=O)C(C)C)/C |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Germacrane sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Curcuma Kwangsiensis (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Curcuma Longa (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Curcuma Phaeocaulis (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Curcuma Wenyujin (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Curcuma Zedoaria (Plant) Rel Props:Source_db:cmaup_ingredients