(17S)-7,8-Didehydro-4,5alpha-epoxy-17-methylmorphinan-3,6alpha-diol 17-oxide
PubChem CID: 5362459
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Morphine N-oxide, MORPHINE-N-OXIDE, 639-46-3, Genomorphine, Genomorphin, Morphine oxide, DEA No. 9307, EINECS 211-355-8, 9E77NL2Y9I, MORPHINE, N-OXIDE, IDS-NM-012, DTXSID301018237, Morphinan-3,6-alpha-diol, 7,8-didehydro-4,5-alpha-epoxy-17-methyl-, 17-oxide, Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl-, (5-alpha,6-alpha)-, 17-oxide, MORPHINE SULFATE IMPURITY F [EP IMPURITY], (17S)-7,8-DIDEHYDRO-4,5.ALPHA.-EPOXY-17-METHYLMORPHINAN-3,6.ALPHA.-DIOL 17-OXIDE, Morphine N-Oxide (100?g/ml in Methanol), MORPHINE SULFATE IMPURITY F (EP IMPURITY), UNII-9E77NL2Y9I, (S)-2-[4-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-propanoic Acid Methyl Ester, , SCHEMBL619646, CHEBI:7002, AMAPEXTUMXQULJ-APQDOHRLSA-N, DTXCID301476471, (4R,4aR,7S,7aR,12bS)-3-methyl-3-oxido-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro(3,2-e)isoquinoline-3-ium-7,9-diol, (4R,4aR,7S,7aR,12bS)-3-methyl-3-oxido-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-3-ium-7,9-diol, Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl- (5.alpha.,6.alpha.)-, 17-oxide, NS00042110, Q6913407, MORPHINE HYDROCHLORIDE IMPURITY F [EP IMPURITY], (5?,6?)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol 17-Oxide, , (17S)-7,8-Didehydro-4,5alpha-epoxy-17-methylmorphinan-3,6alpha-diol 17-oxide, MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-METHYL-(5ALPHA,6ALPHA)-, 17-OXIDE, (17S)-7,8-Didehydro-4,5alpha-epoxy-17-methylmorphinan-3,6alpha-diol 17-Oxide (Morphine N-Oxide), MORPHINAN-3,6-DIOL, 7,8-DIDEHYDRO-4,5-EPOXY-17-METHYL-(5.ALPHA.,6.ALPHA.)-, 17-OXIDE, Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl-, (5-alpha,6-alpha)-, 17-oxide (9CI) |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 67.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CC3CCCC45C(CCCC34)CC(C1)C25 |
| Np Classifier Class | Morphinan alkaloids, Isoquinoline alkaloids |
| Deep Smiles | O[C@H]C=C[C@@H][C@][C@H]6Occ5cC[C@H]9[N+]CC%11))[O-])C))))ccc6O |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Morphinans |
| Scaffold Graph Node Level | C1CC2CC3NCCC45C(CCCC34)OC(C1)C25 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 539.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (4R,4aR,7S,7aR,12bS)-3-methyl-3-oxido-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7,9-diol |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 0.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C17H19NO4 |
| Scaffold Graph Node Bond Level | C1=CC2C3Cc4cccc5c4C2(CC[NH2+]3)C(C1)O5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AMAPEXTUMXQULJ-APQDOHRLSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5294117647058824 |
| Logs | -1.127 |
| Rotatable Bond Count | 0.0 |
| Logd | -0.617 |
| Synonyms | morphine n-oxide, morphine-n-oxide |
| Esol Class | Very soluble |
| Functional Groups | CC=CC, CO, C[N+](C)(C)[O-], cO, cOC |
| Compound Name | (17S)-7,8-Didehydro-4,5alpha-epoxy-17-methylmorphinan-3,6alpha-diol 17-oxide |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 301.131 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 301.131 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 301.34 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -1.7463385818181816 |
| Inchi | InChI=1S/C17H19NO4/c1-18(21)7-6-17-10-3-5-13(20)16(17)22-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-,18?/m0/s1 |
| Smiles | C[N+]1(CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)O)O[C@H]3[C@H](C=C4)O)[O-] |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Papaver Album (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Papaver Argemone (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Papaver Bracteatum (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Papaver Caucasicum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Papaver Commutatum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Papaver Dubium (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Papaver Fugax (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Papaver Glaucum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Papaver Hybrid (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Papaver Hybridum (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Papaver Nudicaule (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Papaver Orientale (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Papaver Persicum (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Papaver Pseudocanescens (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Papaver Radicatum (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Papaver Rhoeas (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all; Reference: - 18. Outgoing r'ship
FOUND_INto/from Papaver Tatricum (Plant) Rel Props:Reference: