(5R,6S)-5,6-Epoxy-7-megastigmen-9-one
PubChem CID: 5352481
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-Ionone epoxide, 23267-57-4, 4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one, (E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one, .beta.-Ionon-5,6-epoxide, (5R,6S)-5,6-Epoxy-7-megastigmen-9-one, beta-ionone 5,6-epoxide, 4-(2,2,6-Trimethyl-7-oxabicyclo[4.1.0]hept-1-yl)-3-buten-2-one, Epoxy-.beta.-ionone, 5,6-Epoxy-.beta.-ionone, .beta.-Ionone-5,6-epoxide, .beta.-Ionone-5,6-epoxyde, 5,6-.beta.-Ionone epoxide, SCHEMBL1774698, CHEMBL3355912, SCHEMBL17627686, CHEBI:87546, CHEBI:208937, 7-Oxabicyclo[4.1.0]heptane, 3-buten-2-one deriv., (e)-4-(2,2,6-trimethyl-7-oxa-bicyclo[4.1.0]heptan-1-yl)but-3-en-2-one, 4-(1',2'-epoxy-2',6',6'-trimethyl-2'-cyclohex-1'-yl)-3-buten-2-one, (3E)-4-{2,2,6-TRIMETHYL-7-OXABICYCLO[4.1.0]HEPTAN-1-YL}BUT-3-EN-2-ONE |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 29.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CC2C1 |
| Np Classifier Class | Apocarotenoids (β-) |
| Deep Smiles | CC=O)/C=C/COC3C)CCCC7C)C |
| Heavy Atom Count | 15.0 |
| Classyfire Class | Oxepanes |
| Description | (5r,6s)-5,6-epoxy-7-megastigmen-9-one, also known as 5,6-epoxy-beta-ionone, is a member of the class of compounds known as oxepanes. Oxepanes are compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms (5r,6s)-5,6-epoxy-7-megastigmen-9-one is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). (5r,6s)-5,6-epoxy-7-megastigmen-9-one can be found in garden tomato and root vegetables, which makes (5r,6s)-5,6-epoxy-7-megastigmen-9-one a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CCC2OC2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 329.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)but-3-en-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Oxepanes |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 2.0 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C13H20O2 |
| Scaffold Graph Node Bond Level | C1CCC2OC2C1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | ZTJZJYUGOJYHCU-RMKNXTFCSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.7692307692307693 |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Synonyms | 4-(2,2,6-Trimethylbicyclo[4.1.0]hept-1-yl)-3-buten-2-one, 9CI, 5,6-Epoxy-5,6-dihydro-b-ionone, 5,6-Epoxy-beta-ionone, 5,6-epoxy-β-ionone, beta-ionone epoxide, β- ionone epoxide, β-ionone epoxide |
| Esol Class | Soluble |
| Functional Groups | CC(=O)/C=C/C1(C)OC1(C)C |
| Compound Name | (5R,6S)-5,6-Epoxy-7-megastigmen-9-one |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 208.146 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 208.146 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 208.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.2405661999999995 |
| Inchi | InChI=1S/C13H20O2/c1-10(14)6-9-13-11(2,3)7-5-8-12(13,4)15-13/h6,9H,5,7-8H2,1-4H3/b9-6+ |
| Smiles | CC(=O)/C=C/C12C(CCCC1(O2)C)(C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Oxepanes |
| Np Classifier Superclass | Apocarotenoids |
- 1. Outgoing r'ship
FOUND_INto/from Citrullus Lanatus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Codiaeum Variegatum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2017.1422440 - 3. Outgoing r'ship
FOUND_INto/from Craibiodendron Yunnanense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Crocus Sativus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Origanum Vulgare (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2007.10643545 - 7. Outgoing r'ship
FOUND_INto/from Pachira Aquatica (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1571950 - 8. Outgoing r'ship
FOUND_INto/from Taxus Wallichiana (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10644112 - 9. Outgoing r'ship
FOUND_INto/from Trifolium Repens (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2010.9700417