2-Norbornanol, 3,3-dimethyl-
PubChem CID: 534794
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Camphenilol, 2-Norbornanol, 3,3-dimethyl-, 3-Camphenilanol, Bicyclo[2.2.1]heptan-2-ol, 3,3-dimethyl-, 5957-68-6, SCHEMBL6899186, exo-3,3-Dimethylnorbornan-2-ol, HXUXMDQJDDDOIJ-UHFFFAOYSA-N, 3,3-Dimethylbicyclo[2.2.1]heptan-2-ol # |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CCC1C2 |
| Np Classifier Class | Camphane monoterpenoids |
| Deep Smiles | OCCCCCC6C)C))C5 |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CC2CCC1C2 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 151.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,3-dimethylbicyclo[2.2.1]heptan-2-ol |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H16O |
| Scaffold Graph Node Bond Level | C1CC2CCC1C2 |
| Inchi Key | HXUXMDQJDDDOIJ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | camphenilol |
| Esol Class | Soluble |
| Functional Groups | CO |
| Compound Name | 2-Norbornanol, 3,3-dimethyl- |
| Exact Mass | 140.12 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 140.12 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 140.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C9H16O/c1-9(2)7-4-3-6(5-7)8(9)10/h6-8,10H,3-5H2,1-2H3 |
| Smiles | CC1(C2CCC(C2)C1O)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Reticulata (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2016.1232609