7a-Hydroxycholesterol
PubChem CID: 53477732
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 7a-Hydroxycholesterol, CHEBI:89281, Q27161467 |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 29.0 |
| Pathway Kegg Map Id | map00120 |
| Description | 7alpha-hydroxycholesterol is an oxysterol and can serve as a biomarker for lipid peroxidation. (PMID: 17386651) Products of cholesterol oxidation accumulate within atherosclerotic plaque and have been proposed to contribute to inflammatory signalling in the diseased artery. (PMID: 17364953) 7alpha-hydroxycholesterol is a cholesterol oxide that has been described as biomarker of oxidative stress in subjects with impaired glucose tolerance and diabetes. (PMID: 16634125) [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 624.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 8.0 |
| Iupac Name | (3S,7S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| Prediction Hob | 1.0 |
| Xlogp | 7.4 |
| Molecular Formula | C27H46O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OYXZMSRRJOYLLO-AWBHSAGMSA-N |
| Fcsp3 | 0.925925925925926 |
| Logs | -5.498 |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Logd | 5.768 |
| Synonyms | 7 alpha-Hydroxycholesterol, 7-a-Hydroxycholesterol, 7-alpha-hydroxycholesterol, 7alpha-Hydroxycholesterol, Cholest-5-ene-3beta,7alpha-diol |
| Compound Name | 7a-Hydroxycholesterol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 402.35 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 402.35 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 402.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -6.6874106000000015 |
| Inchi | InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29/h16-18,20-25,28-29H,6-15H2,1-5H3/t18-,20+,21-,22-,23+,24-,25?,26+,27-/m1/s1 |
| Smiles | C[C@H](CCCC(C)C)[C@H]1CC[C@H]2[C@@]1(CC[C@H]3C2[C@@H](C=C4[C@@]3(CC[C@@H](C4)O)C)O)C |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Chelidonium Majus (Plant) Rel Props:Source_db:cmaup_ingredients