(6R)-6-[(3R,5S,7R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid
PubChem CID: 53477686
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 77.8 |
|---|---|
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 31.0 |
| Pathway Kegg Map Id | map00120 |
| Description | 3a,7a-Dihydroxycoprostanic acid is a bile acid excreted in small amounts in the urine of healthy subjects (PMID 864325) 3a,7a-Dihydroxycoprostanic acid is the precursor to chenodeoxycholic acid A bile acid. Bile acids are steroid acids found predominantly in bile of mammals. The distinction between different bile acids is minute, depends only on presence or absence of hydroxyl groups on positions 3, 7, and 12. Bile acids are physiological detergents that facilitate excretion, absorption, and transport of fats and sterols in the intestine and liver. Bile acids are also steroidal amphipathic molecules derived from the catabolism of cholesterol. They modulate bile flow and lipid secretion, are essential for the absorption of dietary fats and vitamins, and have been implicated in the regulation of all the key enzymes involved in cholesterol homeostasis. Bile acids recirculate through the liver, bile ducts, small intestine and portal vein to form an enterohepatic circuit. They exist as anions at physiological pH and, consequently, require a carrier for transport across the membranes of the enterohepatic tissues. The unique detergent properties of bile acids are essential for the digestion and intestinal absorption of hydrophobic nutrients. Bile acids have potent toxic properties (e.g., membrane disruption) and there are a plethora of mechanisms to limit their accumulation in blood and tissues. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 664.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Enzyme Uniprot Id | Q14032, Q9Y2P5 |
| Iupac Name | (6R)-6-[(3R,5S,7R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| Prediction Hob | 1.0 |
| Xlogp | 6.6 |
| Molecular Formula | C27H46O4 |
| Prediction Swissadme | 1.0 |
| Inchi Key | ITZYGDKGRKKBSN-KLYSAGIUSA-N |
| Fcsp3 | 0.9629629629629628 |
| Logs | -4.444 |
| Rotatable Bond Count | 6.0 |
| State | Solid |
| Logd | 4.764 |
| Synonyms | 3a,7a-Dihydroxy-5b-cholestan-26-oate, 3a,7a-Dihydroxy-5b-cholestan-26-oic acid, 3a,7a-Dihydroxy-5b-cholestanoate, 3a,7a-Dihydroxy-5b-cholestanoic acid, 3a,7a-Dihydroxycoprostanate, 3a,7a-Dihydroxycoprostanic acid, 3a,7a-Hydroxy-5b-cholestan-26-oate, 3a,7a-Hydroxy-5b-cholestan-26-oic acid, 3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oate, 3alpha,7alpha-Dihydroxy-5beta-cholestan-26-oic acid, 3alpha,7alpha-Dihydroxy-5beta-cholestanate, 3alpha,7alpha-dihydroxy-5beta-cholestanic acid, 3alpha,7alpha-Dihydroxy-5beta-cholestanoate, 3alpha,7alpha-dihydroxy-5beta-cholestanoic acid |
| Compound Name | (6R)-6-[(3R,5S,7R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 434.34 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 434.34 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 434.7 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 11.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -5.118798200000001 |
| Inchi | InChI=1S/C27H46O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h16-24,28-29H,5-15H2,1-4H3,(H,30,31)/t16-,17?,18+,19-,20-,21+,22+,23-,24?,26+,27-/m1/s1 |
| Smiles | C[C@H](CCCC(C)C(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Lycopus Lucidus (Plant) Rel Props:Source_db:cmaup_ingredients