(-)-Tracheloside
PubChem CID: 53462879
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Tracheloside |
|---|---|
| Topological Polar Surface Area | 174.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | LWYAMIUSVGPFKS-UHFFFAOYSA-N |
| Rotatable Bond Count | 10.0 |
| State | Solid |
| Synonyms | (-)-Tracheloside, Tracheloside |
| Heavy Atom Count | 39.0 |
| Compound Name | (-)-Tracheloside |
| Kingdom | Organic compounds |
| Description | Constituent of Carthamus tinctorius (safflower). Tracheloside is found in safflower, fats and oils, and herbs and spices. |
| Exact Mass | 550.205 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 550.205 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 799.0 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 550.6 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[[3-methoxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one |
| Total Atom Stereocenter Count | 7.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Lignan glycosides |
| Inchi | InChI=1S/C27H34O12/c1-34-17-6-4-14(9-19(17)35-2)8-16-13-37-26(32)27(16,33)11-15-5-7-18(20(10-15)36-3)38-25-24(31)23(30)22(29)21(12-28)39-25/h4-7,9-10,16,21-25,28-31,33H,8,11-13H2,1-3H3 |
| Smiles | COC1=C(C=C(C=C1)CC2COC(=O)C2(CC3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O)OC |
| Xlogp | 1.0 |
| Superclass | Lignans, neolignans and related compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Lignan glycosides |
| Molecular Formula | C27H34O12 |
- 1. Outgoing r'ship
FOUND_INto/from Carthamus Tinctorius (Plant) Rel Props:Source_db:fooddb_chem_all