3-Tetradecynoic acid
PubChem CID: 534441
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3-Tetradecynoic acid, 3-Tetradecanynoic acid, tetradec-3-ynoic acid, 55182-76-8, 3-Tetradecynoic acid #, DTXSID30336541, CHEBI:196051, NXRVELJJJOMFAM-UHFFFAOYSA-N, LMFA01030584 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Hydrocarbons |
| Deep Smiles | CCCCCCCCCCC#CCC=O)O |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 232.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | tetradec-3-ynoic acid |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 5.3 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H24O2 |
| Inchi Key | NXRVELJJJOMFAM-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 9.0 |
| Synonyms | 3-tetradecynoic acid |
| Esol Class | Soluble |
| Functional Groups | CC#CC, CC(=O)O |
| Compound Name | 3-Tetradecynoic acid |
| Exact Mass | 224.178 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 224.178 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 224.34 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-10,13H2,1H3,(H,15,16) |
| Smiles | CCCCCCCCCCC#CCC(=O)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Cestrum Nocturnum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2010.10643871