Epitulipinolide
PubChem CID: 5322173
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | EPITULIPINOLIDE, [(6E,10E)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate, 24164-13-4, Tulipinolide_major, NSC106405, NSC142844, NSC-106405, NSC-142844, NCGC00385946-01 |
|---|---|
| Topological Polar Surface Area | 52.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | UPNVKIZABMRHNR-BBYAVRKXSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | Tulipinolide, 6,10-Dimethyl-3-methylidene-2-oxo-2H,3H,3ah,4H,5H,8H,9H,11ah-cyclodeca[b]furan-4-yl acetic acid |
| Heavy Atom Count | 21.0 |
| Compound Name | Epitulipinolide |
| Kingdom | Organic compounds |
| Description | Tulipinolide belongs to germacranolides and derivatives class of compounds. Those are sesquiterpene lactones with a structure based on the germacranolide skeleton, characterized by a gamma lactone fused to a 1,7-dimethylcyclodec-1-ene moiety. Tulipinolide is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Tulipinolide can be found in sweet bay, which makes tulipinolide a potential biomarker for the consumption of this food product. |
| Exact Mass | 290.152 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 290.152 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 527.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 290.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [(6E,10E)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 2.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+ |
| Smiles | C/C/1=C\C2C(C(C/C(=C/CC1)/C)OC(=O)C)C(=C)C(=O)O2 |
| Xlogp | 2.4 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 2.0 |
| Subclass | Terpene lactones |
| Taxonomy Direct Parent | Germacranolides and derivatives |
| Molecular Formula | C17H22O4 |
- 1. Outgoing r'ship
FOUND_INto/from Laurus Nobilis (Plant) Rel Props:Source_db:fooddb_chem_all