Triacontanedioic acid
PubChem CID: 5322010
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Triacontanedioic acid, 6708-53-8, Equisetolic acid, LMFA01170042, SCHEMBL1236072, DTXSID30415789, CHEBI:165389 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Dicarboxylic acids |
| Deep Smiles | OC=O)CCCCCCCCCCCCCCCCCCCCCCCCCCCCC=O)O |
| Heavy Atom Count | 34.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 396.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | triacontanedioic acid |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 12.9 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H58O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JADFUOUIMWDTFX-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.9333333333333332 |
| Logs | -4.456 |
| Rotatable Bond Count | 29.0 |
| Logd | 3.56 |
| Synonyms | triacontanedioic acid |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)O |
| Compound Name | Triacontanedioic acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 482.434 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 482.434 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 482.8 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -10.873398800000004 |
| Inchi | InChI=1S/C30H58O4/c31-29(32)27-25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28-30(33)34/h1-28H2,(H,31,32)(H,33,34) |
| Smiles | C(CCCCCCCCCCCCCCC(=O)O)CCCCCCCCCCCCCC(=O)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty Acids and Conjugates |
- 1. Outgoing r'ship
FOUND_INto/from Cirsium Arvense (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Equisetum Arvense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Equisetum Debile (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Equisetum Diffusum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Equisetum Hyemale (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Equisetum Palustre (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Equisetum Pratense (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Equisetum Ramosissimum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Thlaspi Arvense (Plant) Rel Props:Reference: