Toddaculin
PubChem CID: 5321960
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Toddaculin, 4335-12-0, Toddaculine, 2H-1-Benzopyran-2-one, 5,7-dimethoxy-6-(3-methyl-2-butenyl)-, 6-(3-Methyl-2-butenyl)-5,7-dimethoxy-2H-1-benzopyran-2-one, 5,7-dimethoxy-6-(3-methylbut-2-enyl)chromen-2-one, CHEMBL3235996, DTXSID00195829, 5,7-Dimethoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one, starbld0003785, SCHEMBL15941538, DTXCID90118320, EAA33512, HY-N9359, BDBM50008740, AKOS040763013, DA-78522, MS-23895, CS-0159520, E80586, 5,7-DIMETHOXY-6-(3-METHYLBUT-2-EN-1-YL)CHROMEN-2-ONE |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 44.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC2C1 |
| Np Classifier Class | Simple coumarins |
| Deep Smiles | COcccoc=O)ccc6cc%10CC=CC)C)))))OC |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Coumarins and derivatives |
| Scaffold Graph Node Level | OC1CCC2CCCCC2O1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 409.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q08499 |
| Iupac Name | 5,7-dimethoxy-6-(3-methylbut-2-enyl)chromen-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT1464 |
| Xlogp | 3.8 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H18O4 |
| Scaffold Graph Node Bond Level | O=c1ccc2ccccc2o1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | KRQHZFHWEAJPNO-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.3125 |
| Logs | -4.374 |
| Rotatable Bond Count | 4.0 |
| Logd | 3.156 |
| Synonyms | toddaculin, toddaculine[5,7-dimethoxy-6-(2-isopentenyl)-coumarin] |
| Esol Class | Moderately soluble |
| Functional Groups | CC=C(C)C, c=O, cOC, coc |
| Compound Name | Toddaculin |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 274.121 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 274.121 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 274.31 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.9634592 |
| Inchi | InChI=1S/C16H18O4/c1-10(2)5-6-11-13(18-3)9-14-12(16(11)19-4)7-8-15(17)20-14/h5,7-9H,6H2,1-4H3 |
| Smiles | CC(=CCC1=C(C=C2C(=C1OC)C=CC(=O)O2)OC)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Barringtonia Asiatica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Berberis Asiatica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Buddleja Asiatica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Centella Asiatica (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Chomelia Asiatica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Colubrina Asiatica (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Gmelina Asiatica (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Grewia Asiatica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Gynostemma Longipes (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Gynostemma Pentaphyllum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Gynostemma Yixingense (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Leea Asiatica (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Malus Asiatica (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Plantago Asiatica (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Striga Asiatica (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Tarenna Asiatica (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Tetracera Asiatica (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Toddalia Aculeata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Toddalia Asiatica (Plant) Rel Props:Source_db:npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Toddalia Floribunda (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Torenia Asiatica (Plant) Rel Props:Reference: