Sinactine
PubChem CID: 5321317
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Tetrahydroepiberberine, Sinactine, 38853-67-7, Sinactin, (+-)-Sinactine, Epiberberine, tetrahydro-, 16,17-dimethoxy-5,7-dioxa-1-azapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene, Tetrahydroepiberberine, Sinactine, 12H-Benzo(a)-1,3-benzodioxolo(4,5-g)quinolizine, 6,6a,11,14-tetrahydro-8,9-dimethoxy-, 6,6a,11,14-Tetrahydro-8,9-dimethoxy-12H-benzo(a)-1,3-benzodioxolo(4,5-g)quinolizine, SCHEMBL2742533, CHEMBL5200898, CHEBI:81368, DTXSID50959635, HY-N3035, NBA85367, AKOS025149078, DA-78351, MS-25169, CS-0023054, NS00094109, C17898, E80730, Q27155305, 8,9-Dimethoxy-6,11,12,14-tetrahydro-2H,6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1CC3C(CCC4CCCC43)CC12 |
| Np Classifier Class | Isoquinoline alkaloids, Protoberberine alkaloids |
| Deep Smiles | COcccccc6OC))))CCNC6Ccccccc6C%10))OCO5 |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Protoberberine alkaloids and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)CCN1CC3C(CCC4OCOC43)CC21 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 488.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 16,17-dimethoxy-5,7-dioxa-1-azapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaene |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 3.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C20H21NO4 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)CCN1Cc3c(ccc4c3OCO4)CC21 |
| Prediction Swissadme | 1.0 |
| Inchi Key | UWEHVAXMSWXKRW-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.4 |
| Rotatable Bond Count | 2.0 |
| Synonyms | sinactine |
| Esol Class | Moderately soluble |
| Functional Groups | CN(C)C, c1cOCO1, cOC |
| Compound Name | Sinactine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 339.147 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 339.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 339.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.1267242 |
| Inchi | InChI=1S/C20H21NO4/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3 |
| Smiles | COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C5=C(C=C4)OCO5)OC |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Aglaonema Commutatum (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cocculus Pendulus (Plant) Rel Props:Reference:ISBN:9788185042053 - 3. Outgoing r'ship
FOUND_INto/from Corydalis Meifolia (Plant) Rel Props:Reference:ISBN:9788185042114 - 4. Outgoing r'ship
FOUND_INto/from Cynanchum Acutum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Fumaria Officinalis (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/15366062 - 6. Outgoing r'ship
FOUND_INto/from Papaver Album (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Papaver Argemone (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Papaver Bracteatum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Papaver Caucasicum (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Papaver Commutatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Papaver Dubium (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Papaver Fugax (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Papaver Glaucum (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Papaver Hybrid (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Papaver Hybridum (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Papaver Nudicaule (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Papaver Orientale (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Papaver Persicum (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Papaver Pseudocanescens (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Papaver Radicatum (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Papaver Rhoeas (Plant) Rel Props:Reference:ISBN:9788172362461; ISBN:9788185042145 - 22. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Papaver Tatricum (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Sinomenium Acutum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all