1-Methyl-2-[(6Z,9Z)-6,9-pentadecadienyl]-4(1H)-quinolone
PubChem CID: 5319750
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 120693-52-9, 1-Methyl-2-[(6Z,9Z)-6,9-pentadecadienyl]-4(1H)-quinolone, 1-Methyl-2-[(6Z,9Z)-6,9-pentadecadiene]-4(1H)-quinolone, 4(1H)-Quinolinone, 1-methyl-2-(6Z,9Z)-6,9-pentadecadienyl-, 1-Methyl-2-((6Z,9Z)-pentadeca-6,9-dien-1-yl)quinolin-4(1H)-one, 1-Methyl-2-(6,9-pentadecadienyl)-4(1H)-quinolinone, 1-methyl-2-[(6Z,9Z)-pentadeca-6,9-dienyl]quinolin-4-one, HY-N9520, AKOS030546147, FS-7345, DA-69562, CS-0198366, E88635, 1-Methyl-2-(6Z,9Z)-6,9-pentadecadienyl-4(1H)-quinolone |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCC2CCCCC12 |
| Np Classifier Class | Quinoline alkaloids |
| Deep Smiles | CCCCC/C=CC/C=CCCCCCccc=O)ccn6C))cccc6 |
| Heavy Atom Count | 27.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | OC1CCNC2CCCCC12 |
| Classyfire Subclass | Quinolones and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 516.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-methyl-2-[(6Z,9Z)-pentadeca-6,9-dienyl]quinolin-4-one |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 7.7 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C25H35NO |
| Scaffold Graph Node Bond Level | O=c1cc[nH]c2ccccc12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ZVODRCBOPULJKJ-NQLNTKRDSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.48 |
| Logs | -2.808 |
| Rotatable Bond Count | 12.0 |
| Logd | 4.304 |
| Synonyms | 1-methyl-2-[(6z,9z)6,9-pentadecadienyl]-4(1h)-quinolone |
| Esol Class | Soluble |
| Functional Groups | C/C=CC, c=O, cn(c)C |
| Compound Name | 1-Methyl-2-[(6Z,9Z)-6,9-pentadecadienyl]-4(1H)-quinolone |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 365.272 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 365.272 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 365.6 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Lipinski Rule Of 5 | True |
| Esol | -7.182952274074074 |
| Inchi | InChI=1S/C25H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-21-25(27)23-19-16-17-20-24(23)26(22)2/h7-8,10-11,16-17,19-21H,3-6,9,12-15,18H2,1-2H3/b8-7-,11-10- |
| Smiles | CCCCC/C=C\C/C=C\CCCCCC1=CC(=O)C2=CC=CC=C2N1C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | False |
| Np Classifier Superclass | Tryptophan alkaloids, Anthranilic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Evodia Rutaecarpa (Plant) Rel Props:Source_db:npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Tetradium Ruticarpum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all