(-)-Kaur-16-ene
PubChem CID: 5318786
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-Kaurene, Kaur-16-ene, (-)-Kaur-16-ene, ONVABDHFQKWOSV-BRHLSEQLSA-N |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC23CCC4CCCCC4C2CCC1C3 |
| Np Classifier Class | Kaurane and Phyllocladane diterpenoids, Podocarpane diterpenoids |
| Deep Smiles | C=CC[C@]C[C@H]5CC[C@H]6C[C@H]CC%10))CC)C)CCC6)))))C |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | CC1CC23CCC4CCCCC4C2CCC1C3 |
| Classyfire Subclass | Diterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 445.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (1S,4R,10R,13R)-5,5,9-trimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 6.9 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H32 |
| Scaffold Graph Node Bond Level | C=C1CC23CCC4CCCCC4C2CCC1C3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ONVABDHFQKWOSV-BRHLSEQLSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.9 |
| Rotatable Bond Count | 0.0 |
| Synonyms | α-kaurene |
| Esol Class | Moderately soluble |
| Functional Groups | C=C(C)C |
| Compound Name | (-)-Kaur-16-ene |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 272.25 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 272.25 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 272.5 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -5.8826512 |
| Inchi | InChI=1S/C20H32/c1-14-12-20-11-8-16-18(2,3)9-5-10-19(16,4)17(20)7-6-15(14)13-20/h15-17H,1,5-13H2,2-4H3/t15-,16-,17+,19?,20-/m1/s1 |
| Smiles | CC1(CCCC2([C@@H]1CC[C@]34[C@H]2CC[C@H](C3)C(=C)C4)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Berberis Fortunei (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cephalotaxus Fortunei (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Chloranthus Fortunei (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Cryptomeria Japonica (Plant) Rel Props:Reference:ISBN:9788172362133 - 5. Outgoing r'ship
FOUND_INto/from Cyrtomium Fortunei (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Drynaria Fortunei (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Euonymus Fortunei (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Eupatorium Fortunei (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Illicium Griffithii (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700936 - 10. Outgoing r'ship
FOUND_INto/from Podocarpus Amarus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Podocarpus Blumei (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Podocarpus Dacrydioides (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Podocarpus Elatus (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Podocarpus Elongata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Podocarpus Elongatus (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Podocarpus Hallii (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Podocarpus Henckelii (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Podocarpus Macrophyllus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Podocarpus Minor (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Podocarpus Montanus (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Podocarpus Nagi (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Podocarpus Nakaii (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Podocarpus Neriifolius (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Podocarpus Nivalis (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Podocarpus Nubigenus (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Podocarpus Philippinensis (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Podocarpus Polystachyus (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Podocarpus Salignus (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Podocarpus Sellowii (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Podocarpus Spicatus (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Senecio Macrophyllus (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Silene Fortunei (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Thalictrum Fortunei (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Trachycarpus Fortunei (Plant) Rel Props:Reference: