5,10-dihydroxy-3-[(2Z)-2-(hydroxymethyl)-6-methoxy-6-methylocta-2,7-dienoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
PubChem CID: 5318727
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 134.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1C2CCC2C3CCCCC3CCC21 |
| Np Classifier Class | Lanostane, Tirucallane and Euphane triterpenoids, Oleanane triterpenoids |
| Deep Smiles | OC/C=C/CCCC=C))OC))C)))))/C=O)OCCCC=O)O))CO)CCC=CCCC6C)CCCC6C)CCCC6C)C))O))))))))))))C6CC%10C)C)))))C |
| Heavy Atom Count | 49.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1C2CCC2C3CCCCC3CCC21 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1400.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,10-dihydroxy-3-[(2Z)-2-(hydroxymethyl)-6-methoxy-6-methylocta-2,7-dienoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 7.0 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C41H64O8 |
| Scaffold Graph Node Bond Level | C1=C2C3CCCCC3CCC2C2CCC3CCCCC3C2C1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ABUHNUYXXJPKKG-MXAYSNPKSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.8048780487804879 |
| Logs | -4.241 |
| Rotatable Bond Count | 10.0 |
| Logd | 4.435 |
| Synonyms | julibrogenin a |
| Esol Class | Poorly soluble |
| Functional Groups | C/C=C(/C)C(=O)OC, C=CC, CC(=O)O, CC=C(C)C, CO, COC |
| Compound Name | 5,10-dihydroxy-3-[(2Z)-2-(hydroxymethyl)-6-methoxy-6-methylocta-2,7-dienoyl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 684.46 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 684.46 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 684.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 11.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | False |
| Esol | -7.855621000000003 |
| Inchi | InChI=1S/C41H64O8/c1-11-37(6,48-10)18-12-13-25(24-42)33(45)49-32-23-41(34(46)47)27(21-35(32,2)3)26-14-15-29-38(7)19-17-30(43)36(4,5)28(38)16-20-39(29,8)40(26,9)22-31(41)44/h11,13-14,27-32,42-44H,1,12,15-24H2,2-10H3,(H,46,47)/b25-13- |
| Smiles | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CC(C2(CC1OC(=O)/C(=C\CCC(C)(C=C)OC)/CO)C(=O)O)O)C)C)(C)C)O)C)C |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Albizia Adinocephala (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Albizia Amara (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Albizia Chinensis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Albizia Gummifera (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Albizia Inundata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Albizia Julibrissin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Albizia Lebbeck (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Albizia Lucidior (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Albizia Myriophylla (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Albizia Odoratissima (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Albizia Procera (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Albizia Saman (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Albizia Schimperana (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ziziphus Glabrata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Ziziphus Mauritiana (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Ziziphus Nummularia (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Ziziphus Oenopolia (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Ziziphus Rugosa (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Ziziphus Sativa (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Ziziphus Xylopyrus (Plant) Rel Props:Reference: