(Z)-7-Hexadecenoic acid
PubChem CID: 5318393
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (Z)-7-Hexadecenoic acid, 2416-19-5, cis-7-Hexadecenoic Acid, (Z)-hexadec-7-enoic acid, hypogeic acid, 7-Hexadecenoic acid, (Z)-, (7Z)-hexadecenoic acid, 7Z-hexadecenoic acid, Hexadec-7-enoic acid, 7-hexadecenoic acid, (7Z)?-7-?Hexadecenoic Acid (Solution in Ethanol), (Z)-7-Hexadecenoic acid, (Z)-7-Hexadecenoic acid, 7Z-Hexadecenoic acid, Hypogeic acid, cis-7-Hexadecenoic acid, 7Z-palmitoleic acid, (Z)-7-Hexadecenoate, hexadec-7Z-enoic acid, Z-7-Hexadecenoic acid, 7(Z)-Hexadecenoic acid, (7Z)-hexadec-7-enoic acid, 16:1 cis7, SCHEMBL410914, (7Z)-7-Hexadecenoic acid #, CHEBI:35465, DTXSID00920496, PJHOFUXBXJNUAC-KTKRTIGZSA-N, HMS3650E21, LMFA01030055, C16:1(n=9), HY-113152, CS-0062289, NS00096492, G90941, SR-01000946779, SR-01000946779-1, Q27116491 |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 18.0 |
| Description | 7z-palmitoleic acid, also known as (Z)-7-hexadecenoic acid or 16:1 cis7, is a member of the class of compounds known as long-chain fatty acids. Long-chain fatty acids are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Thus, 7z-palmitoleic acid is considered to be a fatty acid lipid molecule. 7z-palmitoleic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 7z-palmitoleic acid can be found in peanut, which makes 7z-palmitoleic acid a potential biomarker for the consumption of this food product. 7z-palmitoleic acid can be found primarily in blood. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 209.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (Z)-hexadec-7-enoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Xlogp | 6.4 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acids and conjugates |
| Molecular Formula | C16H30O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PJHOFUXBXJNUAC-KTKRTIGZSA-N |
| Fcsp3 | 0.8125 |
| Logs | -3.383 |
| Rotatable Bond Count | 13.0 |
| State | Solid |
| Logd | 3.177 |
| Synonyms | (Z)-7-Hexadecenoic acid, 16:1 cis7, 7-Hexadecenoic acid, C16:1(N=9), (Z)-7-Hexadecenoate, 7-Hexadecenoate, Hypogeate, 7Z-Palmitoleate, Hypogeic acid |
| Compound Name | (Z)-7-Hexadecenoic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 254.225 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 254.225 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 254.41 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | -4.692166799999999 |
| Inchi | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h9-10H,2-8,11-15H2,1H3,(H,17,18)/b10-9- |
| Smiles | CCCCCCCC/C=C\CCCCCC(=O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Long-chain fatty acids |
- 1. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cnidium Monnieri (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:cmaup_ingredients