gamma-l-Glutamyl-l-valine
PubChem CID: 5317736
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-l-glutamyl-l-valine, SCHEMBL2566456, CHEBI:166843, 2-amino-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid |
|---|---|
| Topological Polar Surface Area | 130.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 17.0 |
| Description | From onion (Allium cepa). N-gamma-L-Glutamyl-L-valine is found in garden onion, soft-necked garlic, and onion-family vegetables. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 303.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -2.8 |
| Superclass | Organic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C10H18N2O5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AQAKHZVPOOGUCK-UHFFFAOYSA-N |
| Fcsp3 | 0.7 |
| Logs | -2.255 |
| Rotatable Bond Count | 7.0 |
| State | Solid |
| Logd | 0.744 |
| Synonyms | g-Glu-val, gamma-Glu-val, gamma-Glutamylvaline |
| Substituent Name | N-acyl-aliphatic-alpha amino acid, Alpha-amino acid, Methyl-branched fatty acid, Branched fatty acid, Amino fatty acid, Fatty acyl, Fatty acid, Dicarboxylic acid or derivatives, Organic 1,3-dipolar compound, Propargyl-type 1,3-dipolar organic compound, Carboxylic acid, Carboximidic acid derivative, Carboximidic acid, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Carbonyl group, Amine, Aliphatic acyclic compound |
| Compound Name | gamma-l-Glutamyl-l-valine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 246.122 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 246.122 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 246.26 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 0.5252694 |
| Inchi | InChI=1S/C10H18N2O5/c1-5(2)8(10(16)17)12-7(13)4-3-6(11)9(14)15/h5-6,8H,3-4,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17) |
| Smiles | CC(C)C(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Lotus Corniculatus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all