1-[3,5-Bis[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one
PubChem CID: 5316836
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 211.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(CC2CCCC(CC3CCCCC3)C2)CC1 |
| Np Classifier Class | Oligomeric phloroglucinols (phlorotannins) |
| Deep Smiles | COccC)cO)ccc6C=O)CC)C))))O))CccO)cCccO)cC)ccc6O))C=O)CC)C))))OC)))))))ccc6O))C=O)CC)C))))O |
| Heavy Atom Count | 48.0 |
| Classyfire Class | Diarylheptanoids |
| Scaffold Graph Node Level | C1CCC(CC2CCCC(CC3CCCCC3)C2)CC1 |
| Classyfire Subclass | Linear diarylheptanoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1040.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-[3,5-bis[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 7.8 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C36H44O12 |
| Scaffold Graph Node Bond Level | c1ccc(Cc2cccc(Cc3ccccc3)c2)cc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | FBKJBTAHNUQRBX-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.4166666666666667 |
| Logs | -3.71 |
| Rotatable Bond Count | 12.0 |
| Logd | 2.011 |
| Synonyms | agrimol g |
| Esol Class | Poorly soluble |
| Functional Groups | cC(C)=O, cO, cOC |
| Compound Name | 1-[3,5-Bis[[2,6-dihydroxy-4-methoxy-3-methyl-5-(2-methylpropanoyl)phenyl]methyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 668.283 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 668.283 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 668.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Esol | -8.373063200000002 |
| Inchi | InChI=1S/C36H44O12/c1-13(2)25(37)22-31(43)20(11-18-28(40)16(7)35(47-9)23(33(18)45)26(38)14(3)4)30(42)21(32(22)44)12-19-29(41)17(8)36(48-10)24(34(19)46)27(39)15(5)6/h13-15,40-46H,11-12H2,1-10H3 |
| Smiles | CC1=C(C(=C(C(=C1OC)C(=O)C(C)C)O)CC2=C(C(=C(C(=C2O)C(=O)C(C)C)O)CC3=C(C(=C(C(=C3O)C)OC)C(=O)C(C)C)O)O)O |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Phloroglucinols |
- 1. Outgoing r'ship
FOUND_INto/from Agave Americana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Agrimonia Eupatoria (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Agrimonia Japonica (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Agrimonia Pilosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Bidens Pilosa (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Brunfelsia Americana (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Calea Pilosa (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Cordia Americana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Curculigo Pilosa (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Elsholtzia Pilosa (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Erythrina Americana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Euphorbia Pilosa (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Genipa Americana (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Isolona Pilosa (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Mammea Africana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Mammea Americana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Mammea Longifolia (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Mammea Siamensis (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Mammea Suriga (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Oleandra Pilosa (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Phytolacca Americana (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Portulaca Pilosa (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Ulmus Americana (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Vepris Pilosa (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Vigna Pilosa (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Viola Pilosa (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Waltheria Americana (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Ximenia Americana (Plant) Rel Props:Reference: