Dehydrogingerdione
PubChem CID: 5316449
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dehydrogingerdione, (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one, 189128-20-9 |
|---|---|
| Topological Polar Surface Area | 66.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 21.0 |
| Description | Dehydrogingerdione is a member of the class of compounds known as methoxyphenols. Methoxyphenols are compounds containing a methoxy group attached to the benzene ring of a phenol moiety. Dehydrogingerdione is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Dehydrogingerdione can be found in ginger, which makes dehydrogingerdione a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 373.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (1Z,3Z)-3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)deca-1,3-dien-5-one |
| Nih Violation | False |
| Class | Phenols |
| Xlogp | 4.2 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Methoxyphenols |
| Molecular Formula | C17H22O4 |
| Inchi Key | FZWNRFAUDBWSKY-YUKZMVOFSA-N |
| Rotatable Bond Count | 8.0 |
| Synonyms | 6-dehydrogingerdione |
| Compound Name | Dehydrogingerdione |
| Kingdom | Organic compounds |
| Exact Mass | 290.152 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 290.152 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 290.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Inchi | InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-12,19-20H,3-6H2,1-2H3/b9-7-,15-12- |
| Smiles | CCCCCC(=O)/C=C(/C=C\C1=CC(=C(C=C1)O)OC)\O |
| Defined Bond Stereocenter Count | 2.0 |
| Taxonomy Direct Parent | Methoxyphenols |
- 1. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:fooddb_chem_all