Bisdemethoxycurcumin
PubChem CID: 5315472
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Bisdemethoxycurcumin, 33171-05-0, 24939-16-0, Curcumin III, Didemethoxycurcumin, (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione, Bis(4-hydroxycinnamoyl)methane, Bis-demethoxycurcumin, Bisdemethoxycucurmin, bisdesmethoxycurcumin, (E,E)-Bisdemethoxycurcumin, Bis(p-hydroxycinnamoyl)methane, 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxyphenyl)-, BHCMT, Curcumin Lll, 2EFO1BP34R, Bisdemethoxy Curcumin, CHEBI:71045, 1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione, NSC687839, INS NO.100(III), CHEMBL105350, INS-100(III), DTXSID00872663, E-100(III), C19H16O4, BISDESMETHOXYCURCUMIN [USP-RS], 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxyphenyl)-, (1E,6E)-, 1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione, 22608-12-4, 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxyphenyl)-, (E,E)-, 1,7-BIS-(4-HYDROXYPHENYL)-HEPTA-1,6-DIENE-3,5-DIONE, BISDESMETHOXYCURCUMIN (USP-RS), bisdemethoxy-curcumin, p,p'-Dihydroxydicinnamoylmethane, UNII-2EFO1BP34R, Curcumin III, Didemethoxycurcumin, DTXSID80865174, Curcuminoid A, (1E,6E)-1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione, Curcumin III, MFCD03419284, di-p-coumaroylmethane, Dide Methoxycurcu Min, BDMC, (E,E)-Curcumin III, SCHEMBL428638, SCHEMBL13521971, cid_5324473, HY-N0007A, HY-N0007R, DTXCID10820312, DTXCID40813611, (1E,6E)-1,7-Bis(4-hydroxyphenyl)-hepta-1,6-diene-3,5-dione, ZAA93916, BIS-DEMETHOXYCURCUMIN [INCI], BDBM50059989, AKOS015902102, (E,E)-Bisdemethoxycurcumin (Standard), CCG-207959, CCG-208635, FB64958, NSC-687839, Bisdemethoxycurcumin, analytical standard, 1ST40222, AC-24239, AC-34720, AS-57295, AS-68737, BB300038, DA-71539, B3347, Bisdemethoxycurcumin, >=98% (HPLC), solid, CS-0018287, NS00116324, S3938, (E,E)-Bisdemethoxycurcumin - Bio-X trade mark, A12429, Q4917168, BISDESMETHOXYCURCUMIN (CONSTITUENT OF TURMERIC), BRD-K37445107-001-01-9, 1,7-bis(4-hydroxyphenyl)-1,6-Heptadiene-3,5-dione(E,E), 1,7-bis(4-hydroxyphenyl)-3-hydroxy-1,3,6-heptatrien-5-one, (1E,6E)-1,7-Bis-(4-hydroxy-phenyl)-hepta-1,6-diene-3,5-dione, 5-Hydroxy-1,7-bis-(4-hydroxy-phenyl)-hepta-1,4,6-trien-3-one, (1E,4Z,6E)-5-Hydroxy-1,7-bis-(4-hydroxy-phenyl)-hepta-1,4,6-trien-3-one, 607-464-9 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CCC1CCCCC1)CC(C)CCC1CCCCC1 |
| Np Classifier Class | Linear diarylheptanoids |
| Deep Smiles | O=CCC=O)/C=C/cccccc6))O)))))))))/C=C/cccccc6))O |
| Heavy Atom Count | 23.0 |
| Classyfire Class | Diarylheptanoids |
| Scaffold Graph Node Level | OC(CCC1CCCCC1)CC(O)CCC1CCCCC1 |
| Classyfire Subclass | Linear diarylheptanoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 408.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q7ZJM1, P35354, P05979, P79208, n.a., P15840, P43071, Q04760, Q9UQM7, O42275, P81908, P05067, O60218, P15121 |
| Iupac Name | (1E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Diarylheptanoids |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT31, NPT1566, NPT1674, NPT1270, NPT41 |
| Xlogp | 3.3 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Linear diarylheptanoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C19H16O4 |
| Scaffold Graph Node Bond Level | O=C(C=Cc1ccccc1)CC(=O)C=Cc1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PREBVFJICNPEKM-YDWXAUTNSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0526315789473684 |
| Logs | -3.427 |
| Rotatable Bond Count | 6.0 |
| State | Solid |
| Logd | 2.917 |
| Synonyms | 1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione, Bis(4-hydroxycinnamoyl)methane, Bis(p-hydroxycinnamoyl)methane, Curcumin III, Didemethoxycurcumin, 1,7-Bis(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione(e,e), Bis-demethoxycurcumin, bidesmethoxycurcumin, bis-desmethoxycurcumin, bisdemethoxycurcumin, curcumin iii, di-p-coumaroylmethane, didemethoxycurcumin |
| Esol Class | Soluble |
| Functional Groups | c/C=C/C(C)=O, cO |
| Compound Name | Bisdemethoxycurcumin |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 308.105 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 308.105 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 308.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.795551556521739 |
| Inchi | InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12,20-21H,13H2/b11-5+,12-6+ |
| Smiles | C1=CC(=CC=C1/C=C/C(=O)CC(=O)/C=C/C2=CC=C(C=C2)O)O |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Curcuminoids |
| Np Classifier Superclass | Diarylheptanoids |
- 1. Outgoing r'ship
FOUND_INto/from Adiantum Capillus-Veneris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Alpinia Blepharocalyx (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Alpinia Galanga (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Curcuma Kwangsiensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Curcuma Longa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Curcuma Phaeocaulis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Curcuma Wenyujin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Curcuma Zedoaria (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Fraxinus Quadrangulata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Goniothalamus Borneensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Jacobaea Maritima (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all