(16R)-ent-kauran-16,19-diol
PubChem CID: 52916190
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ent-16b-Kauran-16,19-diol, (16R)-ent-kauran-16,19-diol |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | XZESVXVYTBMYCR-WVMNWVHYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | (-)-Ent-kauran-16-beta-19-diol, 16b-ent-Kauran-16,19-diol, ent-16b-Kauran-16,19-diol |
| Heavy Atom Count | 22.0 |
| Compound Name | (16R)-ent-kauran-16,19-diol |
| Kingdom | Organic compounds |
| Description | Ent-16b-kauran-16,19-diol is a member of the class of compounds known as kaurane diterpenoids. Kaurane diterpenoids are diterpene alkaloids with a structure that is based on the kaurane skeleton. Kaurane is a tetracyclic compound that arises by cyclisation of a pimarane precursor followed by rearrangement. It possesses a [3,2,1]-bicyclic ring system with C15-C16 bridge connected to C13, forming the five-membered ring D. Ent-16b-kauran-16,19-diol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Ent-16b-kauran-16,19-diol can be found in sunflower, which makes ent-16b-kauran-16,19-diol a potential biomarker for the consumption of this food product. |
| Exact Mass | 306.256 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 306.256 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 476.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 306.5 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 7.0 |
| Iupac Name | (1S,4S,5R,9S,10R,13R,14R)-5-(hydroxymethyl)-5,9,14-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol |
| Total Atom Stereocenter Count | 7.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C20H34O2/c1-17(13-21)8-4-9-18(2)15(17)7-10-20-11-14(5-6-16(18)20)19(3,22)12-20/h14-16,21-22H,4-13H2,1-3H3/t14-,15-,16+,17+,18-,19-,20+/m1/s1 |
| Smiles | C[C@]1(CCC[C@@]2([C@@H]1CC[C@]34[C@H]2CC[C@H](C3)[C@](C4)(C)O)C)CO |
| Xlogp | 4.5 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Diterpenoids |
| Taxonomy Direct Parent | Kaurane diterpenoids |
| Molecular Formula | C20H34O2 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all