3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol
PubChem CID: 5290
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D,L-Stepholidine, 16562-14-4, 6H-Dibenzo[a,g]quinolizine-2,10-diol, 5,8,13,13a-tetrahydro-3,9-dimethoxy-, 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol, CHEMBL595489, DTXSID00274461, Probes1_000256, Probes2_000298, SCHEMBL460434, CHEBI:91837, (12bS)-4,10-dimethoxy-7,8,12b,13-tetrahydro-5H-6-azatetraphene-3,11-diol, BDBM50152837, HSCI1_000061, AKOS030254427, 3,9-Dimethoxy-5,8,13,13A-Tetrahydro-6H-Isoquino[3,2-A]Isoquinoline-2,10-Diol, (A+/-)-Berbine-2,10-diol, 3,9-dimethoxy-, Q7611023, BRD-A71203467-001-01-5 |
|---|---|
| Topological Polar Surface Area | 62.2 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 24.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 447.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q99720, P35462, P14416, P21728 |
| Iupac Name | 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Protoberberine alkaloids and derivatives |
| Target Id | NPT296, NPT244, NPT243, NPT242 |
| Xlogp | 2.6 |
| Superclass | Alkaloids and derivatives |
| Is Pains | False |
| Molecular Formula | C19H21NO4 |
| Prediction Swissadme | 1.0 |
| Inchi Key | JKPISQIIWUONPB-UHFFFAOYSA-N |
| Fcsp3 | 0.3684210526315789 |
| Logs | -1.724 |
| Rotatable Bond Count | 2.0 |
| Logd | 2.826 |
| Synonyms | Stepholidine, (-)-Stepholidine, L-Stepholidine |
| Compound Name | 3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,10-diol |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 327.147 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 327.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 327.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -3.739456 |
| Inchi | InChI=1S/C19H21NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3 |
| Smiles | COC1=C(C=C2C3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)O |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Protoberberine alkaloids and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Fibraurea Chloroleuca (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Fibraurea Recisa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Fibraurea Tinctoria (Plant) Rel Props:Reference: