Episterol
PubChem CID: 5283662
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Episterol, 474-68-0, Ergosta-7,24(28)-dien-3-ol, 24-methylene-cholest-7-en-3beta-ol, CHEBI:23929, DTXSID40963827, (3beta,5alpha)-ergosta-7,24(28)-dien-3-ol, Ergosta-7,24(28)-dien-3-ol, (3beta,5alpha)-, (3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol, 5alpha-ergosta-7,24(28)-dien-3beta-ol, (3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-((2R)-6-methyl-5-methylideneheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta(a)phenanthren-3-ol, 24-Methyl-5a-cholesta-7,24(28)-dien-3ss-ol, 24-Methylene-5a-cholest-7-en-3ss-ol, 24-Methylenecholesta-7,24(28)-dien-3ss-ol, Episterin, Episterol, ?7,24(28)-Ergostadienol, LMST01030115, DTXCID201391557, 5a-ergosta-7,24(28)-dien-3b-ol, Q61014523 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Np Classifier Class | Ergostane steroids, Stigmastane steroids |
| Deep Smiles | O[C@H]CC[C@][C@H]C6)CC=C[C@@H]6CC[C@][C@H]6CC[C@@H]5[C@@H]CCC=C)CC)C)))))C))))))C)))))))))C |
| Heavy Atom Count | 29.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Classyfire Subclass | Ergostane steroids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 659.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 8.0 |
| Uniprot Id | O75845 |
| Iupac Name | (3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Class | Steroids and steroid derivatives |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 8.4 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Ergostane steroids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C28H46O |
| Scaffold Graph Node Bond Level | C1=C2C3CCCC3CCC2C2CCCCC2C1 |
| Inchi Key | BTCAEOLDEYPGGE-JVAZTMFWSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | (3beta,5alpha)-Ergosta-7,24(28)-dien-3-ol, Ergosta-7,24(28)-dien-3-ol, (3b,5a)-Ergosta-7,24(28)-dien-3-ol, (3Β,5α)-ergosta-7,24(28)-dien-3-ol, Episterol, (3beta)-isomer, 24-Methyl-5alpha-cholesta-7,24(28)-dien-3beta-ol, 24-Methyl-5α-cholesta-7,24(28)-dien-3β-ol, 24-Methylene-5alpha-cholest-7-en-3beta-ol, 24-Methylene-5α-cholest-7-en-3β-ol, 24-Methylenecholesta-7,24(28)-dien-3beta-ol, 24-Methylenecholesta-7,24(28)-dien-3β-ol, 5alpha-Ergosta-7,24(28)-dien-3beta-ol, 5α-Ergosta-7,24(28)-dien-3β-ol, Episterin, Episterol, delta7,24(28)-Ergostadienol, Δ7,24(28)-Ergostadienol, 24-methyl-cholest-7-en-3-beta-ol, 24-methylcholest-7-en-3beta-ol, episterol |
| Esol Class | Poorly soluble |
| Functional Groups | C=C(C)C, CC=C(C)C, CO |
| Compound Name | Episterol |
| Kingdom | Organic compounds |
| Exact Mass | 398.355 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 398.355 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 398.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26+,27+,28-/m1/s1 |
| Smiles | C[C@H](CCC(=C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Ergosterols and derivatives |
| Np Classifier Superclass | Steroids |
- 1. Outgoing r'ship
FOUND_INto/from Alangium Salviifolium (Plant) Rel Props:Reference:ISBN:9788185042053 - 2. Outgoing r'ship
FOUND_INto/from Calendula Officinalis (Plant) Rel Props:Reference:ISBN:9788185042084 - 3. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 4. Outgoing r'ship
FOUND_INto/from Cucurbita Pepo (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279