Glyceryl Monooleate
PubChem CID: 5283468
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Monoolein, 111-03-5, Glyceryl monooleate, 2,3-Dihydroxypropyl oleate, 1-Monoolein, Glycerol 1-monooleate, Glyceryl oleate, Glycerin 1-monooleate, 1-Oleoylglycerol, 1-Glyceryl oleate, 1-Oleoyl-rac-glycerol, GLYCEROL MONOOLEATE, 1-Monooleoylglycerol, 1-Monooleoyl-rac-glycerol, Glyceryl 1-oleate, Aldo MO, Aldo HMO, alpha-Monoolein, Glycerol oleate, rac-1-Monooleoylglycerol, Olein, 1-mono-, Danisco MO 90, rac-1-Monoolein, Oleic monoglyceride, .alpha.-Monoolein, Glycerine monooleate, Oleoylglycerol, Olicine, Supeol, 1-Mono(cis-9-octacenoyl)glycerol, Sinnoester ogc, Oleylmonoglyceride, Dimodan LSQK, Emalsy MO, Emalsy OL, 2,3-dihydroxypropyl (Z)-octadec-9-enoate, Adchem GMO, Edenor GMO, Emcol O, Kessco GMO, Nikkol MGO, Oleic acid monoglyceride, Glycerin monooleate, Mazol GMO, Monoglyceryl oleate, Olein, mono-, Glycerol alpha-monooleate, Monoolein (VAN), 25496-72-4, Glycolube 100, monolein, Rikemal ol 100, Aldo MO-FG, Arlacel 129, Dimodan GMO 90, Rikemal O 71D, Sunsoft O 30B, Kemester 2000, Emasol MO 50, Loxiol G 10, Emerest 2421, Alkamuls GMO 45LG, Monomuls 90018, AJAX GMO, Excel O 95F, Excel O 95N, Excel O 95R, Aldo 40, Canamex Glicepol 182, Emrite 6009, Atmer 1007, Emuldan RYLO-MG 90, FEMA No. 2526, 1-Oleylglycerol, Dur-Em 204, Dur-EM 114, Glyceryl Monooleate (VAN), Oleic acid glycerol monoester, Emery oleic acid ester 2221, rac 1-Oleoyl Glycerol, HSDB 493, mono-olein, Oleoyl glycerol, Glycerol alpha-cis-9-octadecenate, Glyceryl monooleate [NF], 1-(9Z-octadecenoyl)-rac-glycerol, GMO 8903, Oleic acid, monoester with glycerol, EINECS 247-038-6, D3AEF6S35P, OL 100, Glycerol, 1-mono (9-octa-decenoate), glyceryl mono-oleate, NSC-406285, S 1096R, 9-OCTADECENOIC ACID (Z)-, 2,3-DIHYDROXYPROPYL ESTER, Monooleoylglycerol, CHEBI:75342, 9-Octadecenoic acid (9Z)-, 2,3-dihydroxypropyl ester, Glyceryl monooleate 90, Glyceryl monooleate 90%, EINECS 203-827-7, 1,2,3-Propanetriol mono((Z)-9-octadecenoate), 9-Octadecenoic acid (Z)-, monoester with 1,2,3-propanetriol, MFCD00042735, S 1096, S 1097, rac-Glycerol 1-monooleate, NSC 406285, Glycerol .alpha.-monooleate, C4YAD5F5G6, Glyceryl cis-9-octadecenoate, 1-(9Z)-octadecenoylglycerol, DTXSID3042003, 9-Octadecenoic acid, 2,3-dihydroxypropyl ester, GLYCERYL MONOOLEATE [FHFI], mono-oleoylglycerol, Glycerol .alpha.-cis-9-octadecenate, 1-(cis-9-Octadecenoyl)-rac-glycerol, 9-Octadecenoic acid, monoester with 1,2,3-propanetriol, Peceol, MG(18:1(9Z)/0:0/0:0)[rac], 9-Octadecenoicacid(Z)-,2,3-dihydroxypropylester, oleoyl-glycerol, 9-Octadecenoic acid (9Z)-, monoester with 1,2,3-propanetriol, 9-Octadecenoic acid (Z)-, 2,3-dihydroxypropyl ester (9CI), 1-oleoyl glycerol, Glycerol 1-oleate, 2,3-dihydroxypropyl (9Z)-octadec-9-enoate, 1-oleoyl-2-glycerol, 1-oleoyl monoglyceride, myverol 18-99, Rylo MG 19, UNII-C4YAD5F5G6, UNII-D3AEF6S35P, Olein, mono, Ablunol GMO, DL-a-Monoolein, dl-alpha-Monoolein, Glycerol-1-oleate, Aldo MOFG, sn-1-O-(cis-9)octadecenylglycerol, Glycerol 1monooleate, Dimodan MO 90, Witconol 2421, dl-.alpha.-Monoolein, Emuldan RYLOMG 90, Glyceryl monooleate 40, Glyceryl monooleate 60, DurEm 114, DurEm 204, Glyceryl monooleate 40%, Olein, 1-mono-(8CI), Olein, 1-mono- (8CI), SCHEMBL15603, 1-GLYCERYL MONOOLEATE, Mazol 300 K (Salt/Mix), 1-(9Z-octadecenoyl)-glycerol, CHEMBL428593, GTPL5756, 1-Oleoyl-rac-glycerol - 50%, DTXCID1022003, DTXSID3027875, GLYCERYL MONOOLEATE [FCC], 1-Oleoyl-rac-glycerol, >=99%, Glycerol, 1mono (9octadecenoate), GLYCERYL MONOOLEATE [HSDB], ENDOCINE COMPONENT MONO-OLEIN, BDBM50529937, GLYCERYL MONOOLEATE [WHO-DD], LMGL01010005, NSC406285, AKOS015966695, BS-1088, DB13171, FO63124, 925-14-4, 1,2,3Propanetriol mono((Z)9octadecenoate), DB-208961, HY-128754, CS-0102558, G0082, 2,3-Dihydroxypropyl (9Z)-9-octadecenoate #, 1-Oleoyl-rac-glycerol, technical, ~40% (TLC), 9-Octadecenoic acid (Z)-,3-dihydroxypropyl ester, cis-9-Octadecenoic acid 2,3-dihydroxypropyl ester, MG (18:1/0:0/0:0), Q27071132, 9-Octadecenenoic acid (Z)-, 2,3-dihydroxypropyl ester, 9-octadecenoic acid, 2,3-dihydroxypropyl ester, (9Z)-, CFF6FE9F-EF1B-4B03-88B1-5421DCF14582, 9Octadecenoic acid (Z), monoester with 1,2,3propanetriol, 9-Octadecenoic acid (9Z)-, 2,3-dihydroxypropyl ester (9CI), 9-Octadecenoic acid (Z)-, monoester with 1,2,3-propanetriol (9CI) |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 66.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Monoacylglycerols |
| Deep Smiles | CCCCCCCC/C=CCCCCCCCC=O)OCCCO))O |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Glycerolipids |
| Classyfire Subclass | Monoradylglycerols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 315.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P35354, P14555, P23743 |
| Iupac Name | 2,3-dihydroxypropyl (Z)-octadec-9-enoate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 6.5 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C21H40O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | RZRNAYUHWVFMIP-KTKRTIGZSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.8571428571428571 |
| Logs | -3.598 |
| Rotatable Bond Count | 19.0 |
| Logd | 4.004 |
| Synonyms | glyceryl monooleate, monoolein |
| Esol Class | Moderately soluble |
| Functional Groups | C/C=CC, CO, COC(C)=O |
| Compound Name | Glyceryl Monooleate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 356.293 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 356.293 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 356.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.8789914 |
| Inchi | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| Smiles | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CO)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Glycerolipids |
- 1. Outgoing r'ship
FOUND_INto/from Andrographis Paniculata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Coriandrum Sativum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1470943 - 4. Outgoing r'ship
FOUND_INto/from Lygodium Japonicum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Mangifera Indica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Senna Obtusifolia (Plant) Rel Props:Reference:ISBN:9788185042145 - 8. Outgoing r'ship
FOUND_INto/from Senna Tora (Plant) Rel Props:Reference:ISBN:9788172362089 - 9. Outgoing r'ship
FOUND_INto/from Setaria Italica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all